missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Adenosine 5'-triphosphate, disodium salt hydrate, 98%
CAS: 34369-07-8 | C10H14N5Na2O13P3 | 551.15 g/mol
$374.84 - $1804.13
Chemical Identifiers
| CAS | 34369-07-8 |
|---|---|
| Molecular Formula | C10H14N5Na2O13P3 |
| Molecular Weight (g/mol) | 551.15 |
| MDL Number | MFCD00150755 |
| InChI Key | TTWYZDPBDWHJOR-WCYUCLFNNA-L |
| PubChem CID | 131664345 |
| IUPAC Name | disodium phosphono ({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)phosphonate |
| SMILES | [Na+].[Na+].NC1=C2N=CN([C@@H]3O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC102800100
|
Thermo Scientific Chemicals
102800100 |
10 g | Glass bottle |
Each for $374.84
|
|
||||
|
AC102800500
|
Thermo Scientific Chemicals
102800500 |
50 g | Glass bottle |
Each for $1,804.13
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 34369-07-8 | |
| 551.15 | |
| TTWYZDPBDWHJOR-WCYUCLFNNA-L | |
| disodium phosphono ({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)phosphonate |
| C10H14N5Na2O13P3 | |
| MFCD00150755 | |
| 131664345 | |
| [Na+].[Na+].NC1=C2N=CN([C@@H]3O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 |
Specifications
| 188.0°C to 190.0°C | |
| Brown to Colorless | |
| 100.0 | |
| Liquid | |
| 97.5% min. (HPLC) | |
| MFCD00150755 | |
| atp disodium salt hydrate, atp disodium salt, atp disodium hydrate, adenosine 5'-triphosphate disodium salt hydrate, atp disodium salt trihydrate, 56-65-5 non-sodium, 987-65-5 anhydrous, 5 inverted exclamation marka-atp-na2, adenosine 5'-triphosphate disodium sal | |
| TTWYZDPBDWHJOR-WCYUCLFNNA-L | |
| disodium phosphono ({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphonato}oxy)phosphonate | |
| 131664345 | |
| 98% | |
| Glass bottle | |
| Adenosine 5'-triphosphate, disodium salt hydrate |
| 34369-07-8 | |
| 97.5 | |
| 2.5 to 3.5 (5% aq. soln.) | |
| 10 g | |
| C10H14N5Na2O13P3 | |
| 14,155 | |
| (5% in water) Clear colorless | |
| [Na+].[Na+].NC1=C2N=CN([C@@H]3O[C@H](COP([O-])(=O)OP([O-])(=O)OP(O)(O)=O)[C@@H](O)[C@H]3O)C2=NC=N1 | |
| 551.15 | |
| 551.14 | |
| Authentic | |
| (5% aq. soln.) clear, colorless |
RUO – Research Use Only