missing translation for 'onlineSavingsMsg'
Learn More
Learn More
9-Benzhydrylidene-10-anthrone, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 388260050
| Quantity | 5g |
|---|
Chemical Identifiers
| 667-91-4 | |
| 358.44 | |
| SPOJSTUMWGMCFP-UHFFFAOYSA-N | |
| 69586 | |
| C1=CC=C(C=C1)C(=C2C3=CC=CC=C3C(=O)C4=CC=CC=C42)C5=CC=CC=C5 |
| C27H18O | |
| MFCD00019172 | |
| 9-benzhydrylidene-10-anthrone, 10-diphenylmethylene anthracen-9 10h-one, 10-diphenylmethylidene anthracen-9-one, anthrafuchson, 10-benzhydrylidene-9-anthrone, 10-diphenylmethylene anthracen-9-one, 9-diphenylmethylene-10 9h-anthracenone, 9 10h-anthracenone,10-diphenylmethylene, 10-diphenylmethylene-9 10h-anthracenone #, 9 10h-anthracenone, 10-diphenylmethylene | |
| 10-benzhydrylideneanthracen-9-one |
Specifications
| 9-Benzhydrylidene-10-anthrone | |
| 94.0 | |
| Authentic | |
| Glass bottle | |
| 5g | |
| 07, 551 | |
| SPOJSTUMWGMCFP-UHFFFAOYSA-N | |
| 10-benzhydrylideneanthracen-9-one | |
| 69586 | |
| 95% |
| 667-91-4 | |
| 100.0 | |
| 94% min. (HPLC) | |
| C27H18O | |
| MFCD00019172 | |
| 9-benzhydrylidene-10-anthrone, 10-diphenylmethylene anthracen-9 10h-one, 10-diphenylmethylidene anthracen-9-one, anthrafuchson, 10-benzhydrylidene-9-anthrone, 10-diphenylmethylene anthracen-9-one, 9-diphenylmethylene-10 9h-anthracenone, 9 10h-anthracenone,10-diphenylmethylene, 10-diphenylmethylene-9 10h-anthracenone #, 9 10h-anthracenone, 10-diphenylmethylene | |
| C1=CC=C(C=C1)C(=C2C3=CC=CC=C3C(=O)C4=CC=CC=C42)C5=CC=CC=C5 | |
| 358.44 | |
| 358.44 |
Safety and Handling
EINECSNumber : 211-570-7
Promotions
Expires: 06-30-2027
Get Up to $1,800 in Chemicals with Purchase
Spend $250 or more on Thermo Fisher Scientific chemicals and get up to $1,800 to spend on additional chemicals.