Learn More
7-Aminocephalosporanic acid, 95-102%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 184410050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 7-Aminocephalosporanic acid | |
| 957-68-6 | |
| 100.0 | |
| 95% min. (HPLC) | |
| C10H12N2O5S | |
| 5g | |
| + 94 | |
| Solubility in water: soluble | |
| CC(=O)OCC1=C(N2C(C(C2=O)N)SC1)C(=O)O | |
| 272.27 | |
| CHEBI:2255 | |
| 95-102% |
| 95-102% | |
| 95.0 | |
| Authentic | |
| Glass bottle | |
| MFCD00005177 | |
| 15, 429 | |
| 7-aminocephalosporanic acid, 7-aca, 7-aminocephalosporinic acid, 7beta-aminocephalosporanic acid, 7-acs, unii-9xi67897rg, 7r-7-aminocephalosporanic acid, 7r-7-aminocephalosporanate, cephalosporanic acid, 7-amino, 6r,7r-3-acetoxymethyl-7-amino-8-oxo-5-thia-1-azabicyclo 4.2.0 oct-2-ene-2-carboxylic acid | |
| HSHGZXNAXBPPDL-HZGVNTEJSA-N | |
| (6R,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | |
| 441328 | |
| 272.27 |
Chemical Identifiers
| 957-68-6 | |
| 272.27 | |
| HSHGZXNAXBPPDL-HZGVNTEJSA-N | |
| 441328 | |
| (6R,7R)-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| C10H12N2O5S | |
| MFCD00005177 | |
| 7-aminocephalosporanic acid, 7-aca, 7-aminocephalosporinic acid, 7beta-aminocephalosporanic acid, 7-acs, unii-9xi67897rg, 7r-7-aminocephalosporanic acid, 7r-7-aminocephalosporanate, cephalosporanic acid, 7-amino, 6r,7r-3-acetoxymethyl-7-amino-8-oxo-5-thia-1-azabicyclo 4.2.0 oct-2-ene-2-carboxylic acid | |
| CHEBI:2255 | |
| CC(=O)OCC1=C(N2C(C(C2=O)N)SC1)C(=O)O |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
May cause allergy or asthma symptoms or breathing difficulties if inhaled.
GHS P Statement
Wear eye protection/face protection.
IF INHALED: If breathing is difficult,remove to fresh air and keep at rest in a position comfortable for breathing.
If experiencing respiratory symptoms: Call a POISON CENTER or doctor
GHS Signal Word: Danger
EINECSNumber : 213-485-0
RUO â Research Use Only