missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ 7-Amino-4-methylcoumarin, Calbiochem™,
Reagent used to prepare fluorogenic 7-amido-4-methylcoumarin (AMC) based substrates for the detection of proteolytic enzyme activity
Supplier: MilliporeSigma™ 16454510MG
Specifications
| 7-Amino-4-methylcoumarin | |
| Yellow | |
| MFCD00006868 | |
| 7-amino-4-methylcoumarin, coumarin 120, 7-amino-4-methyl-2h-chromen-2-one, 2h-1-benzopyran-2-one, 7-amino-4-methyl, coumarin, 7-amino-4-methyl, 4-methyl-7-aminocoumarin, 7-amino-4-methyl-chromen-2-one, unii-ocy3jct44x, ccris 4961, ocy3jct44x | |
| GLNDAGDHSLMOKX-UHFFFAOYSA-N | |
| 7-amino-4-methyl-2H-chromen-2-one | |
| 92249 | |
| 175.2 | |
| HPLC |
| 26093-31-2 | |
| C10H9NO2 | |
| 10 mg | |
| Easily soluble in acetone | |
| CC1=CC(=O)OC2=CC(N)=CC=C12 | |
| 175.19 | |
| CHEBI:51771 | |
| ≥98% | |
| Solid |
Chemical Identifiers
| 26093-31-2 | |
| 175.19 | |
| GLNDAGDHSLMOKX-UHFFFAOYSA-N | |
| 92249 | |
| 7-amino-4-methyl-2H-chromen-2-one |
| C10H9NO2 | |
| MFCD00006868 | |
| 7-amino-4-methylcoumarin, coumarin 120, 7-amino-4-methyl-2h-chromen-2-one, 2h-1-benzopyran-2-one, 7-amino-4-methyl, coumarin, 7-amino-4-methyl, 4-methyl-7-aminocoumarin, 7-amino-4-methyl-chromen-2-one, unii-ocy3jct44x, ccris 4961, ocy3jct44x | |
| CHEBI:51771 | |
| CC1=CC(=O)OC2=CC(N)=CC=C12 |
Safety and Handling
Recommended Storage : 2° to 8°C (35.6° to 46.4°F);