missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5-Nitroindole, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 128700050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 5-Nitroindole | |
| 6146-52-7 | |
| 100.0 | |
| 98.5% min. (GC) | |
| C8H6N2O2 | |
| 5g | |
| Solubility in water: insoluble | |
| C1=CC2=C(C=CN2)C=C1[N+](=O)[O-] | |
| 162.15 | |
| 162.15 |
| 99% | |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| MFCD00005673 | |
| 5-nitroindole, 1h-indole, 5-nitro, indole, 5-nitro, unii-o2bhx6edbn, 5-nitro indole, ccris 3255, o2bhx6edbn, pubchem1711, acmc-209msr | |
| OZFPSOBLQZPIAV-UHFFFAOYSA-N | |
| 5-nitro-1H-indole | |
| 22523 | |
| 99% |
Chemical Identifiers
| 6146-52-7 | |
| 162.15 | |
| OZFPSOBLQZPIAV-UHFFFAOYSA-N | |
| 22523 | |
| C1=CC2=C(C=CN2)C=C1[N+](=O)[O-] |
| C8H6N2O2 | |
| MFCD00005673 | |
| 5-nitroindole, 1h-indole, 5-nitro, indole, 5-nitro, unii-o2bhx6edbn, 5-nitro indole, ccris 3255, o2bhx6edbn, pubchem1711, acmc-209msr | |
| 5-nitro-1H-indole |
Safety and Handling
GHS H Statement
Suspected of causing genetic defects.
GHS P Statement
Use personal protective equipment as required.
GHS Signal Word: Warning
EINECSNumber : 228-153-0
RTECSNumber : NM1168200
RUO â Research Use Only