missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5-(Methoxycarbonyl)-2-methylphenylboronic acid pinacol ester, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 445110010
| Quantity | 1g |
|---|
Description
Chemical Identifiers
| 882679-40-5 | |
| 276.14 | |
| methyl 4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 5-methoxycarbonyl-2-methylphenylboronic acid pinacol ester, amtb518, 5-methoxycarbonyl-2-methylphenylboronic acid, pinacol ester, methyl 4-methyl-3-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl benzoate, 4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid methyl ester, benzoicacid, 4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-, methyl ester, methyl4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-benzoic acid methyl ester | |
| methyl 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| C15H21BO4 | |
| HAPIXNBOBZHNCA-UHFFFAOYSA-N | |
| 53217136 | |
| B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)C |
Specifications
| 5-(Methoxycarbonyl)-2-methylphenylboronic acid pinacol ester | |
| 94% min. (GC) | |
| C15H21BO4 | |
| methyl 4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 5-methoxycarbonyl-2-methylphenylboronic acid pinacol ester, amtb518, 5-methoxycarbonyl-2-methylphenylboronic acid, pinacol ester, methyl 4-methyl-3-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl benzoate, 4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid methyl ester, benzoicacid, 4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-, methyl ester, methyl4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-methyl-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-benzoic acid methyl ester | |
| B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)C | |
| 276.14 | |
| 276.14 |
| 882679-40-5 | |
| Glass Bottle | |
| 1g | |
| HAPIXNBOBZHNCA-UHFFFAOYSA-N | |
| methyl 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | |
| 53217136 | |
| 95% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
IF
GHS Signal Word: Warning