Learn More
(+)-5-Iodo-2'-deoxyuridine, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 122350250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| (+)-5-Iodo-2′-deoxyuridine | |
| 98.5 | |
| 1% max. (1 g, 60°C) (vacuum) | |
| 0.99 | |
| C9H11IN2O5 | |
| 25g | |
| + 280.00 (20.00°C c=1,1M NaOH) | |
| idoxuridine, 5-iodo-2'-deoxyuridine, idoxuridin, 5-iododeoxyuridine, iododeoxyridine, iodoxuridine, iudr, joddeoxiuridin, idoxene, allergan 211 | |
| XQFRJNBWHJMXHO-UHFFFAOYNA-N | |
| 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione | |
| 5905 | |
| 354.09 |
| 54-42-2 | |
| 100 | |
| Authentic | |
| Glass bottle | |
| MFCD00134656 | |
| 15, 4931 | |
| + 280.00 | |
| Solubility in water: 1.6g/L (20°C). Other solubilities: 2.0g/L hcl 0.2n- 74.0g/L naoh 0.2n (25°C),4.4g/L methanol- 2.6g/L alcohol (25°C),0.014g/L ether- 0.003g/L chloroform (25°C),1.6g/L acetone- 1.8g/L ethyl acetate (25°C),5.7 | |
| OCC1OC(CC1O)N1C=C(I)C(=O)NC1=O | |
| 354.10 | |
| CHEBI:147675 | |
| 99% |
Chemical Identifiers
| 54-42-2 | |
| 354.10 | |
| XQFRJNBWHJMXHO-UHFFFAOYNA-N | |
| 5905 | |
| 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| C9H11IN2O5 | |
| MFCD00134656 | |
| idoxuridine, 5-iodo-2'-deoxyuridine, idoxuridin, 5-iododeoxyuridine, iododeoxyridine, iodoxuridine, iudr, joddeoxiuridin, idoxene, allergan 211 | |
| CHEBI:147675 | |
| OCC1OC(CC1O)N1C=C(I)C(=O)NC1=O |
Safety and Handling
Causes serious eye irritation, Suspected of causing genetic defects, Suspected of damaging the unborn child, May cause respiratory irritation, Causes skin irritation
Serious eye damage/eye irritation (category 2), Germ cell mutagenicity (category 2), Reproductive toxicity (category 2), Specific target organ toxicity after single exposure (category 3), Skin corrosion/irritation (category 2)
EINECSNumber : 200-207-8
RUO â Research Use Only