Promotional price valid on web orders only. Your contract pricing may differ. Interested in signing up for a dedicated account number?
Learn More
Learn More
5-Bromo-4-chloro-3-indolyl-β-D-glucuronide Sodium Salt, MP Biomedicals™
A β-glucuronidase substrate which forms an intense blue precipitate upon enzymatic action. Used for the detection of the GUS gene in bacterial colonies and in histochemical applications
Supplier: MP Biomedicals Inc 0219392505
Specifications
| 5-Bromo-4-chloro-3-indolyl-β-D-glucuronide Sodium Salt | |
| White | |
| C14H12BrClNNaO7 | |
| x-gluc sodium salt, x-glca sodium salt, 5-bromo-4-chloro-3-indolyl beta-d-glucopyranosiduronic acid sodium salt | |
| C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)[O-])O)O)O)Cl)Br.[Na+] | |
| 444.594 | |
| 444.6 |
| 129541-41-9 | |
| ≥98% | |
| 5 mg | |
| IBLSVGDGSKUDCT-ILIJQVQCSA-M | |
| sodium;(2R,3S,4S,5S,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate | |
| 53384407 | |
| Powder |
Chemical Identifiers
| 129541-41-9 | |
| 444.594 | |
| x-gluc sodium salt, x-glca sodium salt, 5-bromo-4-chloro-3-indolyl beta-d-glucopyranosiduronic acid sodium salt | |
| sodium;(2R,3S,4S,5S,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| C14H12BrClNNaO7 | |
| IBLSVGDGSKUDCT-ILIJQVQCSA-M | |
| 53384407 | |
| C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)[O-])O)O)O)Cl)Br.[Na+] |