missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5-Bromo-4-Chloro-3-Indolyl-β-D-Galactopyranoside, ≥98%, Molecular Biology Reagent, MP Biomedicals™
5-Bromo-4-Chloro-3-Indolyl-β-D-Galactopyranoside is used as indigogenic substrate for β-galactosidase, for detection of β-galactosidase-positive clones, and the identification of lac and bacterial colonies or phage plaques
Supplier: MP Biomedicals Inc 0219481190
| Quantity | 500 mg |
|---|
Chemical Identifiers
| 7240-90-6 | |
| 408.629 | |
| OPIFSICVWOWJMJ-AEOCFKNESA-N | |
| 65181 | |
| (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| C14H15BrClNO6 | |
| MFCD00005666 | |
| x-gal, 5-bromo-4-chloro-3-beta-d-galactopyranosyloxy indole, 5-bromo-4-chloro-3-indolyl-beta-d-galactoside, unii-v595og374w, 5-bromo-4-chloro-3-indolyl beta-galactoside, 5-bromo-4-chloroindol-3-yl-beta-d-galactopyranoside, 5-bromo-4-chloro-3-indolyl beta-d-galactoside, 5-bromo-4-chloro-3-indolyl-beta-d-galactopyranoside, 5-bromo-4-chloro-3-indolyl beta-d-galactopyranoside, indoxyl-gal | |
| CHEBI:75055 | |
| C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)CO)O)O)O)Cl)Br |
Specifications
| 5-Bromo-4-Chloro-3-Indoyl-β-D-Galactopyranoside | |
| 7240-90-6 | |
| ≥98% | |
| 500 mg | |
| x-gal, 5-bromo-4-chloro-3-beta-d-galactopyranosyloxy indole, 5-bromo-4-chloro-3-indolyl-beta-d-galactoside, unii-v595og374w, 5-bromo-4-chloro-3-indolyl beta-galactoside, 5-bromo-4-chloroindol-3-yl-beta-d-galactopyranoside, 5-bromo-4-chloro-3-indolyl beta-d-galactoside, 5-bromo-4-chloro-3-indolyl-beta-d-galactopyranoside, 5-bromo-4-chloro-3-indolyl beta-d-galactopyranoside, indoxyl-gal | |
| C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)CO)O)O)O)Cl)Br | |
| 408.629 | |
| CHEBI:75055 | |
| Molecular Biology Reagent |
| FTIR | |
| White | |
| C14H15BrClNO6 | |
| MFCD00005666 | |
| OPIFSICVWOWJMJ-AEOCFKNESA-N | |
| (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol | |
| 65181 | |
| 408.6 | |
| Powder |