Learn More
5-Bromo-4-chloro-3-indolyl beta-D-glucuronide sodium salt, 98%
Substrate for beta-glucuronidase | CAS: 129541-41-9 | C14H12BrClNNaO7 | 444.594 g/mol
Supplier: Thermo Scientific Chemicals J6436003
| Quantity | 1 g |
|---|
Description
5-Bromo-4-chloro-3-indolyl beta-D-glucuronide sodium salt is a chromogenic substrate for β-glucuronidase (GUS) gene detection.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Applications5-Bromo-4-chloro-3-indolyl beta-D-glucuronide sodium salt is a chromogenic substrate for β-glucuronidase (GUS) gene detection.
Solubility
Soluble in water at 10mg/ml
Notes
Light sensitive. Incompatible with oxidizing agents and heat.
Chemical Identifiers
| 129541-41-9 | |
| 444.594 | |
| IBLSVGDGSKUDCT-ILIJQVQCSA-M | |
| 53384407 | |
| C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)[O-])O)O)O)Cl)Br.[Na+] |
| C14H12BrClNNaO7 | |
| MFCD00135782 | |
| x-gluc sodium salt, x-glca sodium salt, 5-bromo-4-chloro-3-indolyl beta-d-glucopyranosiduronic acid sodium salt | |
| sodium;(2R,3S,4S,5S,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate |
Specifications
| 5-Bromo-4-chloro-3-indolyl beta-D-glucuronide sodium salt | |
| White | |
| 1 g | |
| Light sensitive | |
| Soluble in water at 10mg/ml | |
| C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)[O-])O)O)O)Cl)Br.[Na+] | |
| 444.594 | |
| 444.59 | |
| Powder |
| 129541-41-9 | |
| C14H12BrClNNaO7 | |
| MFCD00135782 | |
| x-gluc sodium salt, x-glca sodium salt, 5-bromo-4-chloro-3-indolyl beta-d-glucopyranosiduronic acid sodium salt | |
| IBLSVGDGSKUDCT-ILIJQVQCSA-M | |
| sodium;(2R,3S,4S,5S,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate | |
| 53384407 | |
| 98% |
Safety and Handling
TSCA : No
Recommended Storage : Store at -20°C