Learn More
5-Bromo-2'-deoxyuridine, 99%
CAS: 59-14-3 | C9H11BrN2O5 | 307.10 g/mol
$88.27 - $738.16
Chemical Identifiers
| CAS | 59-14-3 |
|---|---|
| Molecular Formula | C9H11BrN2O5 |
| Molecular Weight (g/mol) | 307.10 |
| MDL Number | MFCD00006529 |
| InChI Key | WOVKYSAHUYNSMH-RRKCRQDMSA-N |
| Synonym | 5-bromo-2'-deoxyuridine, broxuridine, bromodeoxyuridine, brdu, 5-bromodeoxyuridine, 5-brdu, budr, 5-bromouracil deoxyriboside, bromouracil deoxyriboside, 5-bromodesoxyuridine |
| PubChem CID | 6035 |
| ChEBI | CHEBI:472552 |
| IUPAC Name | 5-bromo-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(Br)C(=O)NC1=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity & Availability | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity & Availability | |||||
|
AAH27260MD
|
N/A | 250 mg |
Each for $88.27
|
|
|||||
|
AAH2726003
|
N/A | 1 g |
Each for $233.29
|
|
|||||
|
AAH2726006
|
N/A | 5 g |
Each for $738.16
|
|
|||||
Description
5-Bromo-2'-deoxyuridine (BrdU) is a thymidine analog used to label DNA. It is incorporated into newly synthesized DNA in place of thymidine during the S phase of the cell cycle. Cells that were actively proliferating can then be detected by denaturing the DNA and allowing specific antibodies to target the BrdU incorporation. Consequently 5-BrdU is used to study cell signaling and other processes that induce cell proliferation.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Applications5-Bromo-2′-deoxyuridine (BrdU) is a thymidine analog used to label DNA. It is incorporated into newly synthesized DNA in place of thymidine during the S phase of the cell cycle. Cells that were actively proliferating can then be detected by denaturing the DNA and allowing specific antibodies to target the BrdU incorporation. Consequently 5-BrdU is used to study cell signaling and other processes that induce cell proliferation.
Solubility
Soluble in water.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents.
Chemical Identifiers
| 59-14-3 | |
| 307.10 | |
| WOVKYSAHUYNSMH-RRKCRQDMSA-N | |
| 6035 | |
| 5-bromo-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| C9H11BrN2O5 | |
| MFCD00006529 | |
| 5-bromo-2'-deoxyuridine, broxuridine, bromodeoxyuridine, brdu, 5-bromodeoxyuridine, 5-brdu, budr, 5-bromouracil deoxyriboside, bromouracil deoxyriboside, 5-bromodesoxyuridine | |
| CHEBI:472552 | |
| OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(Br)C(=O)NC1=O |
Specifications
| 59-14-3 | |
| C9H11BrN2O5 | |
| 30395 | |
| 5-bromo-2'-deoxyuridine, broxuridine, bromodeoxyuridine, brdu, 5-bromodeoxyuridine, 5-brdu, budr, 5-bromouracil deoxyriboside, bromouracil deoxyriboside, 5-bromodesoxyuridine | |
| WOVKYSAHUYNSMH-RRKCRQDMSA-N | |
| +31° (c=1 in 0.1N HCl) | |
| 307.10 | |
| CHEBI:472552 | |
| 99% |
| ∽190°C (decomposition) | |
| MFCD00006529 | |
| 14,1452 | |
| Soluble in water. | |
| OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(Br)C(=O)NC1=O | |
| 5-bromo-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | |
| 6035 | |
| 307.1 | |
| 5-Bromo-2'-deoxyuridine |
Safety and Handling
GHS H Statement
H341
Suspected of causing genetic defects.
P201-P202-P261-P264b-P271-P280i-P281-P302+P352-P304+P340-P305+P351+P338-P308+P313-P332+P313-P362-P501c
H315-H319-H335-H341
EINECSNumber : 200-415-9
RTECSNumber : YU7350000
TSCA : Yes
Recommended Storage : Keep cold
RUO – Research Use Only