Learn More
5-Aza-2'-deoxycytidine, 98%
CAS: 2353-33-5 | C9H13N3O4 | 227.22 g/mol
$272.80 - $1107.44
Chemical Identifiers
| CAS | 2353-33-5 |
|---|---|
| Molecular Formula | C9H13N3O4 |
| Molecular Weight (g/mol) | 227.22 |
| MDL Number | MFCD00006547 |
| InChI Key | CKTSBUTUHBMZGZ-SHYZEUOFSA-N |
| Synonym | decitabine, 5-aza-2'-deoxycytidine, dacogen, 5-azadeoxycytidine, 2'-deoxy-5-azacytidine, azadc, dezocitidine, 5-aza-cdr, 5-aza-dc, dacogen tn |
| PubChem CID | 451668 |
| ChEBI | CHEBI:50131 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | NC1=NC(=O)N(C=C1)[C@H]1C[C@H](O)[C@@H](CO)O1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC396810100
|
Thermo Scientific Chemicals
396810100 |
10 mg | Glass bottle |
Each for $272.80
|
|
||||
|
AC396810500
|
Thermo Scientific Chemicals
396810500 |
50 mg | Glass bottle |
Each for $1,107.44
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2353-33-5 | |
| 227.22 | |
| CKTSBUTUHBMZGZ-SHYZEUOFSA-N | |
| 451668 | |
| 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| C9H13N3O4 | |
| MFCD00006547 | |
| decitabine, 5-aza-2'-deoxycytidine, dacogen, 5-azadeoxycytidine, 2'-deoxy-5-azacytidine, azadc, dezocitidine, 5-aza-cdr, 5-aza-dc, dacogen tn | |
| CHEBI:50131 | |
| NC1=NC(=O)N(C=C1)[C@H]1C[C@H](O)[C@@H](CO)O1 |
Specifications
| 2353-33-5 | |
| 100.0 | |
| White to Brown | |
| Authentic | |
| Glass bottle | |
| MFCD00006547 | |
| 15, 2856 | |
| Solubility in water: soluble. | |
| NC1=NC(=O)N(C=C1)[C@H]1C[C@H](O)[C@@H](CO)O1 | |
| 227.22 | |
| CHEBI:50131 | |
| 98% | |
| 5-Aza-2′-deoxycytidine |
| 97.5 | |
| 200.0°C | |
| 1% max. | |
| 97.5% min. (HPLC) | |
| C9H13N3O4 | |
| 10 mg | |
| decitabine, 5-aza-2'-deoxycytidine, dacogen, 5-azadeoxycytidine, 2'-deoxy-5-azacytidine, azadc, dezocitidine, 5-aza-cdr, 5-aza-dc, dacogen tn | |
| CKTSBUTUHBMZGZ-SHYZEUOFSA-N | |
| 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one | |
| 451668 | |
| 228.21 | |
| Low Melting Solid |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
Suspected of causing genetic defects.
May damage fertility or the unborn child.
GHS P Statement
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN:
GHS Signal Word: Danger
EINECSNumber : 219-089-4
RUO – Research Use Only