missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5-Aminofluorescein (isomer I) 95.0+%, TCI America™
$305.70 - $958.13
Chemical Identifiers
| CAS | 3326-34-9 |
|---|---|
| Molecular Formula | C20H13NO5 |
| Molecular Weight (g/mol) | 347.33 |
| MDL Number | MFCD00005052 |
| InChI Key | GZAJOEGTZDUSKS-UHFFFAOYSA-N |
| Synonym | 5-aminofluorescein, fluoresceinamine, 4-aminofluorescein, fluoresceinamine isomer i, fluoresceinamine, isomer i, 1-aminofluorescein, spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 5-amino-3',6'-dihydroxy, 5 6-aminofluorescein mixture of isomers, 5-amino-3',6'-dihydroxyspiro 2-benzofuran-1,9'-xanthene-3-one, 5-amino-3',6'-dihydroxy-3h-spiro 2-benzofuran-1,9'-xanthene-3-one |
| PubChem CID | 76845 |
| IUPAC Name | 5-amino-3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| SMILES | NC1=CC=C2C(=C1)C(=O)OC21C2=CC=C(O)C=C2OC2=CC(O)=CC=C12 |
Chemical Identifiers
| 3326-34-9 | |
| 347.33 | |
| GZAJOEGTZDUSKS-UHFFFAOYSA-N | |
| 76845 | |
| NC1=CC=C2C(=C1)C(=O)OC21C2=CC=C(O)C=C2OC2=CC(O)=CC=C12 |
| C20H13NO5 | |
| MFCD00005052 | |
| 5-aminofluorescein, fluoresceinamine, 4-aminofluorescein, fluoresceinamine isomer i, fluoresceinamine, isomer i, 1-aminofluorescein, spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 5-amino-3',6'-dihydroxy, 5 6-aminofluorescein mixture of isomers, 5-amino-3',6'-dihydroxyspiro 2-benzofuran-1,9'-xanthene-3-one, 5-amino-3',6'-dihydroxy-3h-spiro 2-benzofuran-1,9'-xanthene-3-one | |
| 5-amino-3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
Specifications
| 3326-34-9 | |
| MFCD00005052 | |
| 5-aminofluorescein, fluoresceinamine, 4-aminofluorescein, fluoresceinamine isomer i, fluoresceinamine, isomer i, 1-aminofluorescein, spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 5-amino-3',6'-dihydroxy, 5 6-aminofluorescein mixture of isomers, 5-amino-3',6'-dihydroxyspiro 2-benzofuran-1,9'-xanthene-3-one, 5-amino-3',6'-dihydroxy-3h-spiro 2-benzofuran-1,9'-xanthene-3-one | |
| NC1=CC=C2C(=C1)C(=O)OC21C2=CC=C(O)C=C2OC2=CC(O)=CC=C12 | |
| 347.33 | |
| 347.33 | |
| Crystalline Powder |
| C20H13NO5 | |
| 1 g | |
| GZAJOEGTZDUSKS-UHFFFAOYSA-N | |
| 5-amino-3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one | |
| 76845 | |
| ≥95.0% (HPLC,T) | |
| 5-Aminofluorescein (isomer I) |
Safety and Handling
TSCA : Yes