missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5,5-Diphenylhydantoin sodium salt, 99%
CAS: 630-93-3 | C15H11N2NaO2 | 274.26 g/mol
$99.88 - $216.66
Chemical Identifiers
| CAS | 630-93-3 |
|---|---|
| Molecular Formula | C15H11N2NaO2 |
| Molecular Weight (g/mol) | 274.26 |
| MDL Number | MFCD00069674,MFCD00005264 |
| InChI Key | FJPYVLNWWICYDW-UHFFFAOYSA-M |
| Synonym | Phenytoin sodium, Sodium 5, 5-diphenyl-2, 4-imidazolidinedione |
| PubChem CID | 131674077 |
| SMILES | [Na+].O=C1NC(C(=O)[N-]1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC436100250
|
Thermo Scientific Chemicals
436100250 |
25 g | Glass bottle |
Each for $99.88
|
|
||||
|
AC436101000
|
Thermo Scientific Chemicals
436101000 |
100 g | Glass bottle |
Each for $216.66
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 630-93-3 | |
| 274.26 | |
| FJPYVLNWWICYDW-UHFFFAOYSA-M | |
| 131674077 |
| C15H11N2NaO2 | |
| MFCD00069674,MFCD00005264 | |
| Phenytoin sodium, Sodium 5, 5-diphenyl-2, 4-imidazolidinedione | |
| [Na+].O=C1NC(C(=O)[N-]1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 295°C to 298°C | |
| White | |
| 100.0 | |
| 25 g | |
| C15H11N2NaO2 | |
| 15,7433 | |
| Solubility in water: practically insoluble | |
| [Na+].O=C1NC(C(=O)[N-]1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 274.26 | |
| 274.25 | |
| Authentic | |
| 5, 5-Diphenylhydantoin sodium salt |
| 630-93-3 | |
| 98.5 | |
| Crystalline Powder | |
| 99% | |
| MFCD00069674,MFCD00005264 | |
| Phenytoin sodium, Sodium 5, 5-diphenyl-2, 4-imidazolidinedione | |
| FJPYVLNWWICYDW-UHFFFAOYSA-M | |
| sodium 2,5-dioxo-4,4-diphenylimidazolidin-1-ide | |
| 131674077 | |
| 99% | |
| Glass bottle |
Safety and Handling
GHS H Statement
Harmful if swallowed.
May cause an allergic skin reaction.
Suspected of causing cancer.
Suspected of damaging fertility.
Suspected of damaging the unborn child.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing/eye protection/face protection.
Obtain special instructions before use.
IF exposed or concerned: G
GHS Signal Word: Warning
EINECSNumber : 211-148-2
RUO – Research Use Only