missing translation for 'onlineSavingsMsg'
Learn More
Learn More
5-(2-Pyridyl)thiophene-2-sulfonyl chloride, Technical Grade, Thermo Scientific™
Chemical Identifiers
| CAS | 151858-64-9 |
|---|---|
| Molecular Formula | C9H6ClNO2S2 |
| Molecular Weight (g/mol) | 259.72 |
| MDL Number | MFCD00052284 |
| InChI Key | OGOMWPWAEIDEOU-UHFFFAOYSA-N |
| Synonym | 5-2-pyridyl thiophene-2-sulfonyl chloride, 5-pyridin-2-yl thiophene-2-sulfonyl chloride, 2-thiophenesulfonylchloride, 5-2-pyridinyl, 5-pyridin-2-yl thiophene-2-sulphonyl chloride, 5-pyridin-2-yl thiophene-2-sulphonyl chloride, tech, acmc-1c5sp, 5-pyrid-2-ylthiophene-2-sulfonyl chloride, chloro 5-2-pyridyl 2-thienyl sulfone, 2-5-chlorosulphonyl thien-2-yl pyridine, 5-2-pyridyl thiophene-2-sulphonyl chloride |
| PubChem CID | 2737231 |
| IUPAC Name | 5-pyridin-2-ylthiophene-2-sulfonyl chloride |
| SMILES | ClS(=O)(=O)C1=CC=C(S1)C1=CC=CC=N1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
CC02203DA
|
Thermo Scientific Chemicals
CC02203DA |
1g |
N/A
|
N/A | |||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
|
CC02203DE
|
Thermo Scientific Chemicals
CC02203DE |
5g |
N/A
|
N/A | |||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 151858-64-9 | |
| 259.72 | |
| OGOMWPWAEIDEOU-UHFFFAOYSA-N | |
| 2737231 | |
| ClS(=O)(=O)C1=CC=C(S1)C1=CC=CC=N1 |
| C9H6ClNO2S2 | |
| MFCD00052284 | |
| 5-2-pyridyl thiophene-2-sulfonyl chloride, 5-pyridin-2-yl thiophene-2-sulfonyl chloride, 2-thiophenesulfonylchloride, 5-2-pyridinyl, 5-pyridin-2-yl thiophene-2-sulphonyl chloride, 5-pyridin-2-yl thiophene-2-sulphonyl chloride, tech, acmc-1c5sp, 5-pyrid-2-ylthiophene-2-sulfonyl chloride, chloro 5-2-pyridyl 2-thienyl sulfone, 2-5-chlorosulphonyl thien-2-yl pyridine, 5-2-pyridyl thiophene-2-sulphonyl chloride | |
| 5-pyridin-2-ylthiophene-2-sulfonyl chloride |
Specifications
| 151858-64-9 | |
| C9H6ClNO2S2 | |
| 1g | |
| OGOMWPWAEIDEOU-UHFFFAOYSA-N | |
| 5-pyridin-2-ylthiophene-2-sulfonyl chloride | |
| 2737231 | |
| 95% |
| 95% | |
| MFCD00052284 | |
| 5-2-pyridyl thiophene-2-sulfonyl chloride, 5-pyridin-2-yl thiophene-2-sulfonyl chloride, 2-thiophenesulfonylchloride, 5-2-pyridinyl, 5-pyridin-2-yl thiophene-2-sulphonyl chloride, 5-pyridin-2-yl thiophene-2-sulphonyl chloride, tech, acmc-1c5sp, 5-pyrid-2-ylthiophene-2-sulfonyl chloride, chloro 5-2-pyridyl 2-thienyl sulfone, 2-5-chlorosulphonyl thien-2-yl pyridine, 5-2-pyridyl thiophene-2-sulphonyl chloride | |
| ClS(=O)(=O)C1=CC=C(S1)C1=CC=CC=N1 | |
| 259.72 | |
| 259.74 | |
| 5-(2-Pyridyl)thiophene-2-sulfonyl chloride |