Learn More
4'-tert-Butylacetophenone, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 308740010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4'-tert-Butylacetophenone | |
| 943-27-1 | |
| 100.0 | |
| 107.0°C to 108.0°C (5.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.5190 to 1.5220 | |
| MFCD00017256 | |
| 0.96 | |
| Solubility in water: insoluble. Other solubilities: soluble in alkanes,methylene chloride,ethanol,,2-propanol,acetone | |
| CC(=O)C1=CC=C(C=C1)C(C)(C)C | |
| 176.26 | |
| 176.26 |
| 98% | |
| 97.5 | |
| 0.9600g/mL | |
| 29°C | |
| 97.5% min. (GC) | |
| C12H16O | |
| (CH3)3CC6H4COCH3 | |
| 1g | |
| 4'-tert-butylacetophenone, 1-4-tert-butylphenyl ethanone, 4-tert-butylacetophenone, 1-4-tert-butyl phenyl ethanone, p-tert-butylacetophenone, ethanone, 1-4-1,1-dimethylethyl phenyl, acetophenone, 4'-tert-butyl, 1-4-tert-butyl phenyl ethan-1-one, p-t-butylacetophenone, 1-4-tert-butyl-phenyl-ethanone | |
| UYFJYGWNYQCHOB-UHFFFAOYSA-N | |
| 1-(4-tert-butylphenyl)ethanone | |
| 13669 | |
| 98% |
Chemical Identifiers
| 943-27-1 | |
| 176.26 | |
| UYFJYGWNYQCHOB-UHFFFAOYSA-N | |
| 13669 | |
| CC(=O)C1=CC=C(C=C1)C(C)(C)C |
| C12H16O | |
| MFCD00017256 | |
| 4'-tert-butylacetophenone, 1-4-tert-butylphenyl ethanone, 4-tert-butylacetophenone, 1-4-tert-butyl phenyl ethanone, p-tert-butylacetophenone, ethanone, 1-4-1,1-dimethylethyl phenyl, acetophenone, 4'-tert-butyl, 1-4-tert-butyl phenyl ethan-1-one, p-t-butylacetophenone, 1-4-tert-butyl-phenyl-ethanone | |
| 1-(4-tert-butylphenyl)ethanone |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
Wash face,hands and any exposed skin thoroughly
GHS Signal Word: Warning
EINECSNumber : 213-399-3
TSCA : TSCA
RUO â Research Use Only