missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Phenoxybenzaldehyde, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 198930250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4-Phenoxybenzaldehyde | |
| 67-36-7 | |
| 100.0 | |
| 185°C (14.0mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.6100 to 1.612 | |
| MFCD00003383 | |
| 1.132 | |
| QWLHJVDRPZNVBS-UHFFFAOYSA-N | |
| 4-phenoxybenzaldehyde | |
| 66139 | |
| 98% |
| 98% | |
| 97.5 | |
| 1.1320g/mL | |
| >112°C | |
| 97.5% min. (GC) | |
| C13H10O2 | |
| C6H5OC6H4CHO | |
| 25g | |
| p-phenoxybenzaldehyde, 4-formyldiphenyl ether, benzaldehyde, p-phenoxy, benzaldehyde, 4-phenoxy, 4-phenoxy-benzaldehyde, 4-phenyloxy benzaldehyde, diphenyl ether 4-carboxaldehyde, zlchem 548, 4-formyldiphenylether, 4-phenoxy benzaldehyde | |
| O=CC1=CC=C(OC2=CC=CC=C2)C=C1 | |
| 198.22 | |
| 198.22 |
Chemical Identifiers
| 67-36-7 | |
| 198.22 | |
| QWLHJVDRPZNVBS-UHFFFAOYSA-N | |
| 66139 | |
| O=CC1=CC=C(OC2=CC=CC=C2)C=C1 |
| C13H10O2 | |
| MFCD00003383 | |
| p-phenoxybenzaldehyde, 4-formyldiphenyl ether, benzaldehyde, p-phenoxy, benzaldehyde, 4-phenoxy, 4-phenoxy-benzaldehyde, 4-phenyloxy benzaldehyde, diphenyl ether 4-carboxaldehyde, zlchem 548, 4-formyldiphenylether, 4-phenoxy benzaldehyde | |
| 4-phenoxybenzaldehyde |
Safety and Handling
EINECSNumber : 200-650-7
RTECSNumber : CU7560000
RUO â Research Use Only