missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%, C6H4NNa2O6P.6H2O, CAS Number-333338-18-4 | CAS: 333338-18-4 | C6H4NNa2O6P | 263.05 g/mol
$804.46 - $804.46
Chemical Identifiers
| CAS | 333338-18-4 |
|---|---|
| Molecular Formula | C6H4NNa2O6P |
| Molecular Weight (g/mol) | 263.05 |
| MDL Number | MFCD00007319 |
| InChI Key | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| Synonym | pnpp, disodium 4-nitrophenylphosphate, sodium 4-nitrophenyl phosphate, disodium 4-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, disodium salt, disodium p-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2, p-nitrophenyl phosphate, pnpp liquid substrate system |
| PubChem CID | 77949 |
| IUPAC Name | disodium;(4-nitrophenyl) phosphate |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128860100
|
Thermo Scientific Chemicals
128860100 |
10 g | Glass bottle |
Each for $804.46
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 333338-18-4 | |
| 263.05 | |
| VIYFPAMJCJLZKD-UHFFFAOYSA-L | |
| 77949 | |
| [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| C6H4NNa2O6P | |
| MFCD00007319 | |
| pnpp, disodium 4-nitrophenylphosphate, sodium 4-nitrophenyl phosphate, disodium 4-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, disodium salt, disodium p-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2, p-nitrophenyl phosphate, pnpp liquid substrate system | |
| disodium;(4-nitrophenyl) phosphate |
Specifications
| 333338-18-4 | |
| White to Yellow | |
| 0.1% max. free 4-nitrophenol (HPLC) | |
| C6H4NNa2O6P | |
| MFCD00007319 | |
| 06,237 | |
| (5% in water) Clear | |
| [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 | |
| 263.05 | |
| 371.14 | |
| Crystalline Powder or Crystals |
| >300.0°C | |
| Authentic | |
| Glass bottle | |
| O2NC6H4OP(O)(ONa)2·6H2O | |
| 10 g | |
| pnpp, disodium 4-nitrophenylphosphate, sodium 4-nitrophenyl phosphate, disodium 4-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, disodium salt, disodium p-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2, p-nitrophenyl phosphate, pnpp liquid substrate system | |
| VIYFPAMJCJLZKD-UHFFFAOYSA-L | |
| disodium;(4-nitrophenyl) phosphate | |
| 77949 | |
| 98+% | |
| 4-Nitrophenyl phosphate, disodium salt, hexahydrate |
RUO – Research Use Only