Learn More
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%, C6H4NNa2O6P.6H2O, CAS Number-333338-18-4 | CAS: 333338-18-4 | C6H4NNa2O6P | 263.05 g/mol
Supplier: Thermo Scientific Chemicals 128860100
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-Nitrophenyl phosphate, disodium salt, hexahydrate | |
| >300.0°C | |
| Authentic | |
| Glass bottle | |
| O2NC6H4OP(O)(ONa)2·6H2O | |
| 10 g | |
| pnpp, disodium 4-nitrophenylphosphate, sodium 4-nitrophenyl phosphate, disodium 4-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, disodium salt, disodium p-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2, p-nitrophenyl phosphate, pnpp liquid substrate system | |
| VIYFPAMJCJLZKD-UHFFFAOYSA-L | |
| disodium;(4-nitrophenyl) phosphate | |
| 77949 | |
| 98+% |
| 333338-18-4 | |
| White to Yellow | |
| 0.1% max. free 4-nitrophenol (HPLC) | |
| C6H4NNa2O6P | |
| MFCD00007319 | |
| 06,237 | |
| (5% in water) Clear | |
| [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 | |
| 263.05 | |
| 371.14 | |
| Crystalline Powder or Crystals |
Chemical Identifiers
| 333338-18-4 | |
| 263.05 | |
| VIYFPAMJCJLZKD-UHFFFAOYSA-L | |
| 77949 | |
| [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| C6H4NNa2O6P | |
| MFCD00007319 | |
| pnpp, disodium 4-nitrophenylphosphate, sodium 4-nitrophenyl phosphate, disodium 4-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, disodium salt, disodium p-nitrophenyl phosphate, phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2, p-nitrophenyl phosphate, pnpp liquid substrate system | |
| disodium;(4-nitrophenyl) phosphate |
RUO – Research Use Only