missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Nitrophenethyl alcohol, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 179610100
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4-Nitrophenethyl alcohol | |
| 148.0°C to 149.0°C (2.0 Torr) | |
| 98.5% min. (HPLC) | |
| O2NC6H4CH2CH2OH | |
| 06,II,238 | |
| IKMXRUOZUUKSON-UHFFFAOYSA-N | |
| 2-(4-nitrophenyl)ethanol | |
| 7494 | |
| 99% |
| 100-27-6 | |
| Authentic | |
| C8H9NO3 | |
| 10g | |
| 4-nitrophenethyl alcohol, 2-4-nitrophenyl ethanol, 4-nitrobenzeneethanol, 2-p-nitrophenyl ethanol, benzeneethanol, 4-nitro, p-nitrophenethyl alcohol, 2-4-nitrophenyl ethan-1-ol, phenethyl alcohol, p-nitro, ccris 6079, 4-nitrophenethylalcohol | |
| C1=CC(=CC=C1CCO)[N+](=O)[O-] | |
| 167.16 | |
| 167.16 |
Chemical Identifiers
| 100-27-6 | |
| 167.16 | |
| 4-nitrophenethyl alcohol, 2-4-nitrophenyl ethanol, 4-nitrobenzeneethanol, 2-p-nitrophenyl ethanol, benzeneethanol, 4-nitro, p-nitrophenethyl alcohol, 2-4-nitrophenyl ethan-1-ol, phenethyl alcohol, p-nitro, ccris 6079, 4-nitrophenethylalcohol | |
| 2-(4-nitrophenyl)ethanol |
| C8H9NO3 | |
| IKMXRUOZUUKSON-UHFFFAOYSA-N | |
| 7494 | |
| C1=CC(=CC=C1CCO)[N+](=O)[O-] |
Safety and Handling
EINECSNumber : 202-835-8
RUO â Research Use Only