missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-(Methoxycarbonyl)benzeneboronic acid pinacol ester, 97%
CAS: 171364-80-0 | C14H19BO4 | 262.11 g/mol
$53.12 - $178.30
Chemical Identifiers
| CAS | 171364-80-0 |
|---|---|
| Molecular Formula | C14H19BO4 |
| Molecular Weight (g/mol) | 262.11 |
| MDL Number | MFCD02179438 |
| InChI Key | REIZEQZILPXYKS-UHFFFAOYSA-N |
| Synonym | methyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-methoxycarbonylphenylboronic acid pinacol ester, 4-methoxycarbonylphenylboronic acid pinacolate, 4-carbomethoxyphenylboronic acid pinacol ester, 4-methoxycarbonylphenylboronic acid, pinacol ester, 4-methoxycarbonyl phenylboronic acid pinacol ester, methyl 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl-benzoic acid methyl ester, 4-methoxycarbonyl benzeneboronic acid pinacol ester, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid methyl ester |
| PubChem CID | 2773500 |
| IUPAC Name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | COC(=O)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAH2894203
|
Thermo Scientific Chemicals
H2894203 |
1 g |
Each for $53.12
|
|
|||||
|
AAH2894206
|
Thermo Scientific Chemicals
H2894206 |
5 g |
Each for $178.30
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 171364-80-0 | |
| 262.11 | |
| REIZEQZILPXYKS-UHFFFAOYSA-N | |
| 2773500 | |
| COC(=O)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 |
| C14H19BO4 | |
| MFCD02179438 | |
| methyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-methoxycarbonylphenylboronic acid pinacol ester, 4-methoxycarbonylphenylboronic acid pinacolate, 4-carbomethoxyphenylboronic acid pinacol ester, 4-methoxycarbonylphenylboronic acid, pinacol ester, 4-methoxycarbonyl phenylboronic acid pinacol ester, methyl 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl-benzoic acid methyl ester, 4-methoxycarbonyl benzeneboronic acid pinacol ester, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid methyl ester | |
| methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
Specifications
| 171364-80-0 | |
| C14H19BO4 | |
| 1 g | |
| REIZEQZILPXYKS-UHFFFAOYSA-N | |
| methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate | |
| 2773500 | |
| 97% |
| 77°C to 81°C | |
| MFCD02179438 | |
| methyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-methoxycarbonylphenylboronic acid pinacol ester, 4-methoxycarbonylphenylboronic acid pinacolate, 4-carbomethoxyphenylboronic acid pinacol ester, 4-methoxycarbonylphenylboronic acid, pinacol ester, 4-methoxycarbonyl phenylboronic acid pinacol ester, methyl 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl-benzoic acid methyl ester, 4-methoxycarbonyl benzeneboronic acid pinacol ester, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid methyl ester | |
| COC(=O)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 | |
| 262.11 | |
| 262.11 | |
| 4-(Methoxycarbonyl)benzeneboronic acid pinacol ester |
Safety and Handling
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only