Learn More
4'-Isobutylacetophenone, 97%
CAS: 38861-78-8 | C12H16O | 176.26 g/mol
$138.13 - $138.13
Chemical Identifiers
| CAS | 38861-78-8 |
|---|---|
| Molecular Formula | C12H16O |
| Molecular Weight (g/mol) | 176.26 |
| InChI Key | KEAGRYYGYWZVPC-UHFFFAOYSA-N |
| Synonym | 4'-isobutylacetophenone, 4-isobutylacetophenone, p-iso-butylacetophenone, 1-4-isobutylphenyl ethanone, p-isobutylacetophenone, ethanone, 1-4-2-methylpropyl phenyl, 1-4-2-methylpropyl phenyl ethan-1-one, acetophenone, 4-isobutyl, 1-4-2-methylpropyl phenyl ethanone, unii-aml715rd20 |
| PubChem CID | 93214 |
| IUPAC Name | 1-[4-(2-methylpropyl)phenyl]ethanone |
| SMILES | CC(C)CC1=CC=C(C=C1)C(=O)C |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC448820500
|
Thermo Scientific Chemicals
448820500 |
50 g |
Each for $138.13
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 38861-78-8 | |
| 176.26 | |
| 4'-isobutylacetophenone, 4-isobutylacetophenone, p-iso-butylacetophenone, 1-4-isobutylphenyl ethanone, p-isobutylacetophenone, ethanone, 1-4-2-methylpropyl phenyl, 1-4-2-methylpropyl phenyl ethan-1-one, acetophenone, 4-isobutyl, 1-4-2-methylpropyl phenyl ethanone, unii-aml715rd20 | |
| 1-[4-(2-methylpropyl)phenyl]ethanone |
| C12H16O | |
| KEAGRYYGYWZVPC-UHFFFAOYSA-N | |
| 93214 | |
| CC(C)CC1=CC=C(C=C1)C(=O)C |
Specifications
| 38861-78-8 | |
| 107.0°C (2.0 mmHg) | |
| 96% min. (GC) | |
| C12H16O | |
| 50 g | |
| 4'-isobutylacetophenone, 4-isobutylacetophenone, p-iso-butylacetophenone, 1-4-isobutylphenyl ethanone, p-isobutylacetophenone, ethanone, 1-4-2-methylpropyl phenyl, 1-4-2-methylpropyl phenyl ethan-1-one, acetophenone, 4-isobutyl, 1-4-2-methylpropyl phenyl ethanone, unii-aml715rd20 | |
| CC(C)CC1=CC=C(C=C1)C(=O)C | |
| 176.26 | |
| 176.26 | |
| 4'-Isobutylacetophenone |
| 0.9600g/mL | |
| 54°C | |
| Glass Bottle | |
| (CH3)2CHCH2C6H4COCH3 | |
| 0.96 | |
| KEAGRYYGYWZVPC-UHFFFAOYSA-N | |
| 1-[4-(2-methylpropyl)phenyl]ethanone | |
| 93214 | |
| 97% |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
May cause an allergic skin reaction.
Toxic to aquatic life with long lasting effects.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rin
GHS Signal Word: Warning
EINECSNumber : 254-159-8
RUO – Research Use Only