Learn More
4-Fluorobenzenesulfonyl chloride, 98%
CAS: 349-88-2 | C6H4ClFO2S | 194.60 g/mol
$103.16 - $354.69
Chemical Identifiers
| CAS | 349-88-2 |
|---|---|
| Molecular Formula | C6H4ClFO2S |
| Molecular Weight (g/mol) | 194.60 |
| MDL Number | MFCD00007438 |
| InChI Key | BFXHJFKKRGVUMU-UHFFFAOYSA-N |
| Synonym | 4-fluorobenzene-1-sulfonyl chloride, p-fluorobenzenesulfonyl chloride, 4-fluorobenzenesulphonyl chloride, benzenesulfonyl chloride, 4-fluoro, 4-fluorophenylsulfonyl chloride, 4-fluorobenzenesulfonic acid chloride, 4-fluorobenzenesulfonylchloride, benzenesulfonyl chloride, p-fluoro, 4-fluorobenzensulfonyl chloride, 4-fluoro-benzenesulfonyl chloride |
| PubChem CID | 9588 |
| IUPAC Name | 4-fluorobenzenesulfonyl chloride |
| SMILES | FC1=CC=C(C=C1)S(Cl)(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC119350250
|
Thermo Scientific Chemicals
119350250 |
25 g | Glass bottle |
Each for $103.16
|
|
||||
|
AC119351000
|
Thermo Scientific Chemicals
119351000 |
100 g | Glass bottle |
Each for $354.69
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 349-88-2 | |
| 194.60 | |
| BFXHJFKKRGVUMU-UHFFFAOYSA-N | |
| 9588 | |
| FC1=CC=C(C=C1)S(Cl)(=O)=O |
| C6H4ClFO2S | |
| MFCD00007438 | |
| 4-fluorobenzene-1-sulfonyl chloride, p-fluorobenzenesulfonyl chloride, 4-fluorobenzenesulphonyl chloride, benzenesulfonyl chloride, 4-fluoro, 4-fluorophenylsulfonyl chloride, 4-fluorobenzenesulfonic acid chloride, 4-fluorobenzenesulfonylchloride, benzenesulfonyl chloride, p-fluoro, 4-fluorobenzensulfonyl chloride, 4-fluoro-benzenesulfonyl chloride | |
| 4-fluorobenzenesulfonyl chloride |
Specifications
| 349-88-2 | |
| 100.0 | |
| Brown to White | |
| >110°C | |
| 97.5% min. (ex Cl) (Argentometry) | |
| C6H4ClFO2S | |
| MFCD00007438 | |
| 11, 53 | |
| BFXHJFKKRGVUMU-UHFFFAOYSA-N | |
| 4-fluorobenzenesulfonyl chloride | |
| 9588 | |
| 98% | |
| 4-Fluorobenzenesulfonyl chloride |
| 97.5 | |
| 29°C to 34°C | |
| 95°C to 96°C (2.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| FC6H4SO2Cl | |
| 25 g | |
| 4-fluorobenzene-1-sulfonyl chloride, p-fluorobenzenesulfonyl chloride, 4-fluorobenzenesulphonyl chloride, benzenesulfonyl chloride, 4-fluoro, 4-fluorophenylsulfonyl chloride, 4-fluorobenzenesulfonic acid chloride, 4-fluorobenzenesulfonylchloride, benzenesulfonyl chloride, p-fluoro, 4-fluorobenzensulfonyl chloride, 4-fluoro-benzenesulfonyl chloride | |
| FC1=CC=C(C=C1)S(Cl)(=O)=O | |
| 194.60 | |
| 194.61 | |
| Crystalline Low Melting Solid |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 206-493-
RUO – Research Use Only