Learn More
4-(Dimethylamino)phenylboronic acid pinacol ester, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 444960010
| Quantity | 1g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 171364-78-6 | |
| 247.15 | |
| DGMLJJIUOFKPKB-UHFFFAOYSA-N | |
| 2758659 | |
| CN(C)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 |
| C14H22BNO2 | |
| MFCD05663854 | |
| n,n-dimethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl aniline, 4-n,n-dimethylamino phenylboronic acid, pinacol ester, dimethyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl amine, 4-dimethylamino phenylboronic acid pinacol ester, 4-n,n-dimethylamino phenylboronic acid pinacol ester, 2-4-dimethylamino phenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, n,n-dimethyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl amine, n,n-dimethyl-4-tetramethyl-1,3,2-dioxaborolan-2-yl aniline, acmc-209e2t, 4-n,n-dimethylamino phenylboronic acid,pinacol ester | |
| N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
Specifications
| 4-(Dimethylamino)phenylboronic acid pinacol ester | |
| 96% min. (GC) | |
| C14H22BNO2 | |
| 1g | |
| DGMLJJIUOFKPKB-UHFFFAOYSA-N | |
| N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline | |
| 2758659 | |
| 97% |
| 171364-78-6 | |
| Glass Bottle | |
| MFCD05663854 | |
| n,n-dimethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl aniline, 4-n,n-dimethylamino phenylboronic acid, pinacol ester, dimethyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl amine, 4-dimethylamino phenylboronic acid pinacol ester, 4-n,n-dimethylamino phenylboronic acid pinacol ester, 2-4-dimethylamino phenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, n,n-dimethyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl amine, n,n-dimethyl-4-tetramethyl-1,3,2-dioxaborolan-2-yl aniline, acmc-209e2t, 4-n,n-dimethylamino phenylboronic acid,pinacol ester | |
| CN(C)C1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 | |
| 247.15 | |
| 247.14 |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
IF
GHS Signal Word: Warning