Learn More
4-Chlorophenylboronic acid pinacol ester, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 444690050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4-Chlorophenylboronic acid pinacol ester | |
| >110°C | |
| Glass bottle | |
| MFCD05663875 | |
| 2-4-chlorophenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-chlorophenylboronic acid pinacol ester, 4-chlorophenylboronic acid, pinacol ester, 1,3,2-dioxaborolane,2-4-chlorophenyl-4,4,5,5-tetramethyl, 1,3,2-dioxaborolane, 2-4-chlorophenyl-4,4,5,5-tetramethyl, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl chlorobenzene, 4-chlorophenyl boronic acid pinacol ester, 4-chlorobenzeneboronic acid, pinacol ester, p-chlorophenylboronic acid 2,3-dimethyl-2,3-butanediyl | |
| CC1(C)OB(OC1(C)C)C1=CC=C(Cl)C=C1 | |
| 238.52 | |
| 238.52 |
| 195062-61-4 | |
| 96% min. (GC) | |
| C12H16BClO2 | |
| 5g | |
| NYARTXMDWRAVIX-UHFFFAOYSA-N | |
| 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | |
| 10633712 | |
| 97% |
Chemical Identifiers
| 195062-61-4 | |
| 238.52 | |
| NYARTXMDWRAVIX-UHFFFAOYSA-N | |
| 10633712 | |
| CC1(C)OB(OC1(C)C)C1=CC=C(Cl)C=C1 |
| C12H16BClO2 | |
| MFCD05663875 | |
| 2-4-chlorophenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-chlorophenylboronic acid pinacol ester, 4-chlorophenylboronic acid, pinacol ester, 1,3,2-dioxaborolane,2-4-chlorophenyl-4,4,5,5-tetramethyl, 1,3,2-dioxaborolane, 2-4-chlorophenyl-4,4,5,5-tetramethyl, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl chlorobenzene, 4-chlorophenyl boronic acid pinacol ester, 4-chlorobenzeneboronic acid, pinacol ester, p-chlorophenylboronic acid 2,3-dimethyl-2,3-butanediyl | |
| 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
Safety and Handling
GHS H Statement
May cause respiratory irritation.
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
RUO â Research Use Only