Learn More
4'-Chloro-2,2':6',2″-terpyridine, 99%
CAS: 128143-89-5 | C15H10ClN3 | 267.72 g/mol
Supplier: Thermo Scientific Chemicals 319670010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4'-Chloro-2, 2':6', 2''-terpyridine | |
| 128143-89-5 | |
| 100.0 | |
| Brown | |
| 98.5% min. (GC) | |
| C15H10ClN3 | |
| 1 g | |
| Solubility in water: insoluble | |
| ClC1=CC(=NC(=C1)C1=CC=CC=N1)C1=CC=CC=N1 | |
| 267.72 | |
| 267.72 | |
| Crystalline Powder |
| 99% | |
| 98.5 | |
| 148.0°C to 152.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00191930 | |
| 4'-chloro-2,2':6',2-terpyridine, 4'-chloro-2,2':6',2'-terpyridine, 4'-chloro-2,2',6',2-terpyridine, 4-chloro-2,6-bis pyridin-2-yl pyridine, 4-chloro-2,6-di 2-pyridyl pyridine, 4-chloro-6-pyridin-2-yl-2,2'-bipyridine, zlchem 975, acmc-1cg8d, 4'-chloro-2,2'6'2-terpyridine, 4-chloro-2,6-bis 2-pyridyl pyridine | |
| AHEMFMCEBIJRMU-UHFFFAOYSA-N | |
| 4-chloro-2,6-dipyridin-2-ylpyridine | |
| 667748 | |
| 99% |
Chemical Identifiers
| 128143-89-5 | |
| 267.72 | |
| AHEMFMCEBIJRMU-UHFFFAOYSA-N | |
| 667748 | |
| ClC1=CC(=NC(=C1)C1=CC=CC=N1)C1=CC=CC=N1 |
| C15H10ClN3 | |
| MFCD00191930 | |
| 4'-chloro-2,2':6',2-terpyridine, 4'-chloro-2,2':6',2'-terpyridine, 4'-chloro-2,2',6',2-terpyridine, 4-chloro-2,6-bis pyridin-2-yl pyridine, 4-chloro-2,6-di 2-pyridyl pyridine, 4-chloro-6-pyridin-2-yl-2,2'-bipyridine, zlchem 975, acmc-1cg8d, 4'-chloro-2,2'6'2-terpyridine, 4-chloro-2,6-bis 2-pyridyl pyridine | |
| 4-chloro-2,6-dipyridin-2-ylpyridine |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes skin irritation.
Causes serious eye damage.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation occurs: Get medical advice/attention.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
GHS Signal Word: Danger
RUO – Research Use Only