missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Bromo-2-nitrophenol, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 367920050
Specifications
| 4-Bromo-2-nitrophenol | |
| 7693-52-9 | |
| 100.0 | |
| 97.5% min. (GC) | |
| C6H4BrNO3 | |
| MFCD00082540 | |
| 06, IV, 1363 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in ethanol,acetone,toluene | |
| OC1=CC=C(Br)C=C1[N+]([O-])=O | |
| 218.01 | |
| 218.01 |
| 98% | |
| 97.5 | |
| Authentic | |
| Glass bottle | |
| BrC6H3(NO2)OH | |
| 5g | |
| 2-nitro-4-bromophenol, phenol, 4-bromo-2-nitro, 4-bromo-2-nitro-phenol, 4-bromo-1-hydroxy-2-nitrobenzene, phenol, 2-nitro-5-bromo, pubchem4099, 4-brom-2-nitro-phenol, acmc-209p6y, 4-06-00-01363 beilstein handbook reference, ksc494e2j | |
| CUTFAPGINUFNQM-UHFFFAOYSA-N | |
| 4-bromo-2-nitrophenol | |
| 24364 | |
| 98% |
Chemical Identifiers
| 7693-52-9 | |
| 218.01 | |
| CUTFAPGINUFNQM-UHFFFAOYSA-N | |
| 24364 | |
| OC1=CC=C(Br)C=C1[N+]([O-])=O |
| C6H4BrNO3 | |
| MFCD00082540 | |
| 2-nitro-4-bromophenol, phenol, 4-bromo-2-nitro, 4-bromo-2-nitro-phenol, 4-bromo-1-hydroxy-2-nitrobenzene, phenol, 2-nitro-5-bromo, pubchem4099, 4-brom-2-nitro-phenol, acmc-209p6y, 4-06-00-01363 beilstein handbook reference, ksc494e2j | |
| 4-bromo-2-nitrophenol |
Safety and Handling
GHS H Statement
Harmful if inhaled.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Call a POISON CENTER or doctor/physician if you feel unwell.
Wash face,hands and any exposed skin thoroughly after handling.
W
GHS Signal Word: Warning
EINECSNumber : 231-707-4
RUO â Research Use Only