Learn More
4-Biphenylcarboxaldehyde, 99%
CAS: 3218-36-8 | C13H10O | 182.22 g/mol
$71.10 - $71.10
Chemical Identifiers
| CAS | 3218-36-8 |
|---|---|
| Molecular Formula | C13H10O |
| Molecular Weight (g/mol) | 182.22 |
| MDL Number | MFCD00006947 |
| InChI Key | ISDBWOPVZKNQDW-UHFFFAOYSA-N |
| Synonym | 4-biphenylcarboxaldehyde, 4-biphenylaldehyde, p-phenylbenzaldehyde, 1,1'-biphenyl-4-carbaldehyde, biphenyl-4-carboxaldehyde, 4-formylbiphenyl, p-biphenylylaldehyde, 1,1'-biphenyl-4-carboxaldehyde, p-biphenylaldehyde, p-biphenylcarboxaldehyde |
| PubChem CID | 76689 |
| IUPAC Name | 4-phenylbenzaldehyde |
| SMILES | O=CC1=CC=C(C=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC106260050
|
Thermo Scientific Chemicals
106260050 |
5 g | Glass bottle |
Each for $71.10
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 3218-36-8 | |
| 182.22 | |
| ISDBWOPVZKNQDW-UHFFFAOYSA-N | |
| 76689 | |
| O=CC1=CC=C(C=C1)C1=CC=CC=C1 |
| C13H10O | |
| MFCD00006947 | |
| 4-biphenylcarboxaldehyde, 4-biphenylaldehyde, p-phenylbenzaldehyde, 1,1'-biphenyl-4-carbaldehyde, biphenyl-4-carboxaldehyde, 4-formylbiphenyl, p-biphenylylaldehyde, 1,1'-biphenyl-4-carboxaldehyde, p-biphenylaldehyde, p-biphenylcarboxaldehyde | |
| 4-phenylbenzaldehyde |
Specifications
| 3218-36-8 | |
| 100.0 | |
| White to Yellow | |
| Authentic | |
| Glass bottle | |
| C6H5C6H4CHO | |
| 5 g | |
| 4-biphenylcarboxaldehyde, 4-biphenylaldehyde, p-phenylbenzaldehyde, 1,1'-biphenyl-4-carbaldehyde, biphenyl-4-carboxaldehyde, 4-formylbiphenyl, p-biphenylylaldehyde, 1,1'-biphenyl-4-carboxaldehyde, p-biphenylaldehyde, p-biphenylcarboxaldehyde | |
| ISDBWOPVZKNQDW-UHFFFAOYSA-N | |
| 4-phenylbenzaldehyde | |
| 76689 | |
| 99% | |
| 4-Biphenylcarboxaldehyde |
| 98.5 | |
| 57.0°C to 60.0°C | |
| 184.0°C (11.0 mmHg) | |
| 99% | |
| C13H10O | |
| MFCD00006947 | |
| 07, 430 | |
| Solubility in water: insoluble | |
| O=CC1=CC=C(C=C1)C1=CC=CC=C1 | |
| 182.22 | |
| 182.22 | |
| Crystalline Powder or Crystals |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
Wash face,hands and any exposed skin thoroughly after handling.
GHS Signal Word: Warning
EINECSNumber : 221-742-3
RUO – Research Use Only