Learn More
4-Biphenylboronic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 394420250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4-Biphenylboronic acid | |
| 96.0 | |
| Authentic | |
| Glass bottle | |
| C6H5C6H4B(OH)2 | |
| 25g | |
| XPEIJWZLPWNNOK-UHFFFAOYSA-N | |
| (4-phenylphenyl)boronic acid | |
| 151253 | |
| 97% |
| 5122-94-1 | |
| 100.0 | |
| 96% min. (HPLC) | |
| C12H11BO2 | |
| MFCD00093311 | |
| 4-biphenylboronic acid, 1,1'-biphenyl-4-ylboronic acid, biphenyl-4-boronic acid, 4-biphenyl boronic acid, biphenylboronic acid, 4-phenylphenyl boranediol, 4-phenylphenyl boronic acid, biphenyl-4-ylboronic acid, 1,1'-biphenyl-4-yl-boronic acid, 4-phenylbenzeneboronic acid | |
| B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O | |
| 198.03 | |
| 198.03 |
Chemical Identifiers
| 5122-94-1 | |
| 198.03 | |
| XPEIJWZLPWNNOK-UHFFFAOYSA-N | |
| 151253 | |
| B(C1=CC=C(C=C1)C2=CC=CC=C2)(O)O |
| C12H11BO2 | |
| MFCD00093311 | |
| 4-biphenylboronic acid, 1,1'-biphenyl-4-ylboronic acid, biphenyl-4-boronic acid, 4-biphenyl boronic acid, biphenylboronic acid, 4-phenylphenyl boranediol, 4-phenylphenyl boronic acid, biphenyl-4-ylboronic acid, 1,1'-biphenyl-4-yl-boronic acid, 4-phenylbenzeneboronic acid | |
| (4-phenylphenyl)boronic acid |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash
RUO â Research Use Only