Learn More
4-Biphenyl isocyanate, 97%
CAS: 92-95-5 | C13H9NO | 195.22 g/mol
Supplier: Thermo Scientific Chemicals 438500050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-Biphenyl isocyanate | |
| 96.0 | |
| 60.0°C to 61.0°C | |
| 110.0°C to 112.0°C (1.0 mmHg) | |
| 96% min. (GC) | |
| MFCD00037089 | |
| 15,10271 | |
| WIRPZDICFIIBRF-UHFFFAOYSA-N | |
| 1-isocyanato-4-phenylbenzene | |
| 3612319 | |
| 97% |
| 92-95-5 | |
| 100.0 | |
| Brown to Orange | |
| Authentic | |
| C13H9NO | |
| 5 g | |
| 4-biphenylyl isocyanate, p-xenylcarbimide, 4-biphenyl isocyanate, 4-isocyanatobiphenyl, 4-phenylphenyl isocyanate, unii-b0zsp4upq4, 4-biphenylylisocyanate, b0zsp4upq4, p-diphenyl isocyanate, p-xenylcarbimide mi | |
| O=C=NC1=CC=C(C=C1)C1=CC=CC=C1 | |
| 195.22 | |
| 195.22 | |
| Solution |
Chemical Identifiers
| 92-95-5 | |
| 195.22 | |
| WIRPZDICFIIBRF-UHFFFAOYSA-N | |
| 3612319 | |
| O=C=NC1=CC=C(C=C1)C1=CC=CC=C1 |
| C13H9NO | |
| MFCD00037089 | |
| 4-biphenylyl isocyanate, p-xenylcarbimide, 4-biphenyl isocyanate, 4-isocyanatobiphenyl, 4-phenylphenyl isocyanate, unii-b0zsp4upq4, 4-biphenylylisocyanate, b0zsp4upq4, p-diphenyl isocyanate, p-xenylcarbimide mi | |
| 1-isocyanato-4-phenylbenzene |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Causes skin irritation.
May cause an allergic skin reaction.
Causes serious eye irritation.
Harmful if inhaled.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plen
GHS Signal Word: Danger
RUO – Research Use Only