Learn More
4-Aminoantipyrine, 97%
CAS: 83-07-8 | C11H13N3O | 203.245 g/mol
$129.59 - $1765.30
Chemical Identifiers
| CAS | 83-07-8 |
|---|---|
| Molecular Formula | C11H13N3O |
| Molecular Weight (g/mol) | 203.245 |
| MDL Number | MFCD00003145 |
| InChI Key | RLFWWDJHLFCNIJ-UHFFFAOYSA-N |
| Synonym | 4-aminoantipyrine, ampyrone, metapirazone, aminoantipyrine, solvapyrin-a, aminoazophene, 4-aminophenazone, 4-aminoantipyrene, aminoantipyrin, solnapyrin-a |
| PubChem CID | 2151 |
| ChEBI | CHEBI:59026 |
| IUPAC Name | 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1384622
|
Thermo Scientific Chemicals
A1384622 |
100 g |
Each for $129.59
|
|
|||||
|
AAA1384636
|
Thermo Scientific Chemicals
A1384636 |
500 g |
Each for $446.62
|
|
|||||
|
AAA138460E
|
Thermo Scientific Chemicals
A138460E |
2500 g |
Each for $1,765.30
|
|
|||||
Description
4-Aminoantipyrine shows both analgesic and anti-inflammatory properties. It is used as a reagent for glucose determination in the presence of peroxidase and phenol. It is used as a drug dipyrone.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Applications4-Aminoantipyrine shows both analgesic and anti-inflammatory properties. It is used as a reagent for glucose determination in the presence of peroxidase and phenol. It is used as a drug dipyrone.
Solubility
Soluble in water. 500 g/L (20°C), methanol. Partially soluble in diethyl ether.
Notes
Incompatible with Strong oxidizing agents, strong acids, acid chlorides, acid anhydrides.
Chemical Identifiers
| 83-07-8 | |
| 203.245 | |
| RLFWWDJHLFCNIJ-UHFFFAOYSA-N | |
| 2151 | |
| 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one |
| C11H13N3O | |
| MFCD00003145 | |
| 4-aminoantipyrine, ampyrone, metapirazone, aminoantipyrine, solvapyrin-a, aminoazophene, 4-aminophenazone, 4-aminoantipyrene, aminoantipyrin, solnapyrin-a | |
| CHEBI:59026 | |
| CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N |
Specifications
| 83-07-8 | |
| 97% | |
| MFCD00003145 | |
| 181635 | |
| 4-aminoantipyrine, ampyrone, metapirazone, aminoantipyrine, solvapyrin-a, aminoazophene, 4-aminophenazone, 4-aminoantipyrene, aminoantipyrin, solnapyrin-a | |
| RLFWWDJHLFCNIJ-UHFFFAOYSA-N | |
| 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one | |
| 2151 | |
| 203.25 | |
| 4-Aminoantipyrine |
| 106°C to 110°C | |
| C11H13N3O | |
| 100 g | |
| 14,591 | |
| Soluble in water. 500g/L (20°C),methanol. Partially soluble in diethyl ether. | |
| CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N | |
| 203.245 | |
| CHEBI:59026 | |
| 97% |
Safety and Handling
GHS H Statement
H302-H315-H319-H335
P261-P264b-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P312-P330-P332+P313-P362-P501c
H302-H315-H319-H335-H500
EINECSNumber : 201-452-3
RTECSNumber : CD2480000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only