missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Amino-3-hydroxy-1-naphthalene Sulfonic Acid, ACS, 90%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor A11165KGBL
Specifications
| 116-63-2 | |
| 0.001 | |
| C10H9NO4S | |
| RXCMFQDTWCCLBL-UHFFFAOYSA-N | |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid | |
| 0.9 |
| 1 | |
| Poly Pail | |
| 5 kg | |
| NC1=C2C=CC=CC2=C(C=C1O)S(O)(=O)=O | |
| 239.25 | |
| ACS |
Chemical Identifiers
| 116-63-2 | |
| 239.25 | |
| 4-amino-3-hydroxynaphthalene-1-sulfonic acid |
| C10H9NO4S | |
| RXCMFQDTWCCLBL-UHFFFAOYSA-N | |
| NC1=C2C=CC=CC2=C(C=C1O)S(O)(=O)=O |
CAUTION: For manufacturing or laboratory use only. Read and understand the label and Safety Data Sheet (SDS) prior to use.