missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4,7-Diphenyl-1,10-phenanthroline, 99%
CAS: 1662-01-7 | C24H16N2 | 332.39 g/mol
$214.90 - $214.90
Chemical Identifiers
| CAS | 1662-01-7 |
|---|---|
| Molecular Formula | C24H16N2 |
| Molecular Weight (g/mol) | 332.39 |
| MDL Number | MFCD00004976 |
| InChI Key | DHDHJYNTEFLIHY-UHFFFAOYSA-N |
| Synonym | bathophenanthroline, 1,10-phenanthroline, 4,7-diphenyl, bphen, 1,10-bathophenanthroline, bathophenanthrolin, bathophenanthrolin german, unii-4a2b091f0g, 4,7-diphenyl-1,10-diazaphenanthrene, gnf-pf-4554, 4,7-diphenylpyridino 3,2-h quinoline |
| PubChem CID | 72812 |
| ChEBI | CHEBI:77995 |
| IUPAC Name | 4,7-diphenyl-1,10-phenanthroline |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC4=C(C=CN=C4C3=NC=C2)C5=CC=CC=C5 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC158320010
|
Thermo Scientific Chemicals
158320010 |
1 g | Glass bottle |
Each for $214.90
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1662-01-7 | |
| 332.39 | |
| DHDHJYNTEFLIHY-UHFFFAOYSA-N | |
| 72812 | |
| 4,7-diphenyl-1,10-phenanthroline |
| C24H16N2 | |
| MFCD00004976 | |
| bathophenanthroline, 1,10-phenanthroline, 4,7-diphenyl, bphen, 1,10-bathophenanthroline, bathophenanthrolin, bathophenanthrolin german, unii-4a2b091f0g, 4,7-diphenyl-1,10-diazaphenanthrene, gnf-pf-4554, 4,7-diphenylpyridino 3,2-h quinoline | |
| CHEBI:77995 | |
| C1=CC=C(C=C1)C2=C3C=CC4=C(C=CN=C4C3=NC=C2)C5=CC=CC=C5 |
Specifications
| 1662-01-7 | |
| 100.0 | |
| Pink to White | |
| 99% | |
| C24H16N2 | |
| 1 g | |
| Solubility in water: insoluble. | |
| C1=CC=C(C=C1)C2=C3C=CC4=C(C=CN=C4C3=NC=C2)C5=CC=CC=C5 | |
| 332.39 | |
| CHEBI:77995 | |
| 99% | |
| 4, 7-Diphenyl-1, 10-phenanthroline |
| 98.5 | |
| 218.0°C to 221.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00004976 | |
| bathophenanthroline, 1,10-phenanthroline, 4,7-diphenyl, bphen, 1,10-bathophenanthroline, bathophenanthrolin, bathophenanthrolin german, unii-4a2b091f0g, 4,7-diphenyl-1,10-diazaphenanthrene, gnf-pf-4554, 4,7-diphenylpyridino 3,2-h quinoline | |
| DHDHJYNTEFLIHY-UHFFFAOYSA-N | |
| 4,7-diphenyl-1,10-phenanthroline | |
| 72812 | |
| 332.39 | |
| Crystalline Powder, Crystals or Crystalline Mass |
Safety and Handling
EINECSNumber : 216-767-1
RUO – Research Use Only