Learn More
4,5',8-Trimethylpsoralen, 97.5%
CAS: 3902-71-4 | C14H12O3 | 228.25 g/mol
$180.72 - $1,115.83
Chemical Identifiers
| CAS | 3902-71-4 |
|---|---|
| Molecular Formula | C14H12O3 |
| Molecular Weight (g/mol) | 228.25 |
| MDL Number | MFCD00005010 |
| InChI Key | FMHHVULEAZTJMA-UHFFFAOYSA-N |
| Synonym | trioxsalen, trioxysalen, trisoralen, trimethylpsoralen, 4,5',8-trimethylpsoralen, elder 8011, trioxisaleno, trioxysalene, trioxysalenum, 2',4,8-trimethylpsoralen |
| PubChem CID | 5585 |
| ChEBI | CHEBI:28329 |
| IUPAC Name | 2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | CC1=CC2=CC3=C(OC(=O)C=C3C)C(C)=C2O1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC229881000
|
Thermo Scientific Chemicals
229881000 |
100 mg |
N/A
|
|
|||||
|
AC229880010
|
Thermo Scientific Chemicals
229880010 |
1 g |
N/A
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 3902-71-4 | |
| 228.25 | |
| FMHHVULEAZTJMA-UHFFFAOYSA-N | |
| 5585 | |
| 2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| C14H12O3 | |
| MFCD00005010 | |
| trioxsalen, trioxysalen, trisoralen, trimethylpsoralen, 4,5',8-trimethylpsoralen, elder 8011, trioxisaleno, trioxysalene, trioxysalenum, 2',4,8-trimethylpsoralen | |
| CHEBI:28329 | |
| CC1=CC2=CC3=C(OC(=O)C=C3C)C(C)=C2O1 |
Specifications
| 3902-71-4 | |
| 100.0 | |
| White to Beige | |
| Authentic | |
| Glass bottle | |
| MFCD00005010 | |
| 15, 9907 | |
| Solubility in water: insoluble. Other solubilities: sparingly soluble in boiling water,slightly soluble in methanol,ethanol,chloroform | |
| CC1=CC2=CC3=C(OC(=O)C=C3C)C(C)=C2O1 | |
| 228.25 | |
| CHEBI:28329 | |
| 97.5% | |
| 4, 5', 8-Trimethylpsoralen, 97.5% |
| 96.5 | |
| 230.0°C to 234.0°C | |
| 0.5% max. (105°C, 6 hrs) | |
| 96.5% min. (on dried substance) (HPLC) | |
| C14H12O3 | |
| 100 mg | |
| trioxsalen, trioxysalen, trisoralen, trimethylpsoralen, 4,5',8-trimethylpsoralen, elder 8011, trioxisaleno, trioxysalene, trioxysalenum, 2',4,8-trimethylpsoralen | |
| FMHHVULEAZTJMA-UHFFFAOYSA-N | |
| 2,5,9-trimethylfuro[3,2-g]chromen-7-one | |
| 5585 | |
| 228.25 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Suspected of causing cancer.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 223-459-0
RTECSNumber : LV1576000
TSCA : TSCA
RUO – Research Use Only