missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-(4-Methylpiperazino)benzoic acid, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC18701DA
Specifications
| 4-(4-Methylpiperazino)benzoic acid | |
| 96.5 | |
| 97% | |
| C12H16N2O2 | |
| 1g | |
| UCFZVQHKTRSZMM-UHFFFAOYSA-N | |
| 4-(4-methylpiperazin-1-yl)benzoic acid | |
| 736532 | |
| 97% |
| 86620-62-4 | |
| 100.0 | |
| Amber Glass Bottle | |
| MFCD02682063 | |
| 4-4-methylpiperazin-1-yl benzoic acid, 4-4-methylpiperazino benzoic acid, 4-4-methyl-piperazin-1-yl-benzoic acid, 4-4-methylpiperazinyl benzoic acid, 4-4-methyl-piperazino benzoic acid, benzoic acid, 4-4-methyl-1-piperazinyl, 4-4-methyl-1-piperazinyl benzoic acid, pubchem10481, ksc448o3p | |
| CN1CCN(CC1)C2=CC=C(C=C2)C(=O)O | |
| 220.272 | |
| 220.27 |
Chemical Identifiers
| 86620-62-4 | |
| 220.272 | |
| UCFZVQHKTRSZMM-UHFFFAOYSA-N | |
| 736532 | |
| CN1CCN(CC1)C2=CC=C(C=C2)C(=O)O |
| C12H16N2O2 | |
| MFCD02682063 | |
| 4-4-methylpiperazin-1-yl benzoic acid, 4-4-methylpiperazino benzoic acid, 4-4-methyl-piperazin-1-yl-benzoic acid, 4-4-methylpiperazinyl benzoic acid, 4-4-methyl-piperazino benzoic acid, benzoic acid, 4-4-methyl-1-piperazinyl, 4-4-methyl-1-piperazinyl benzoic acid, pubchem10481, ksc448o3p | |
| 4-(4-methylpiperazin-1-yl)benzoic acid |
Safety and Handling
GHS P Statement Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsin
Warning