Learn More
4,4'-Azodianiline, 95%
CAS: 538-41-0 | C12H12N4 | 212.26 g/mol
$559.97 - $1918.84
Chemical Identifiers
| CAS | 538-41-0 |
|---|---|
| Molecular Formula | C12H12N4 |
| Molecular Weight (g/mol) | 212.26 |
| MDL Number | MFCD00041892 |
| InChI Key | KQIKKETXZQDHGE-UHFFFAOYSA-N |
| Synonym | 4,4'-azodianiline, p-azoaniline, p-diaminoazobenzene, 4,4'-diaminoazobenzene, azodianiline, p'-amino-p-aminoazobenzene, 4,4'-azobisbenzenamine, benzenamine, 4,4'-azobis, 4,4-azodianiline, 4,4'-diazenediylbisaniline |
| PubChem CID | 10855 |
| IUPAC Name | 4-[(4-aminophenyl)diazenyl]aniline |
| SMILES | NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC401580050
|
Thermo Scientific Chemicals
401580050 |
5 g | Glass bottle |
Each for $559.97
|
|
||||
|
AC401580250
|
Thermo Scientific Chemicals
401580250 |
25 g | Glass bottle |
Each for $1,918.84
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 538-41-0 | |
| 212.26 | |
| KQIKKETXZQDHGE-UHFFFAOYSA-N | |
| 10855 | |
| NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1 |
| C12H12N4 | |
| MFCD00041892 | |
| 4,4'-azodianiline, p-azoaniline, p-diaminoazobenzene, 4,4'-diaminoazobenzene, azodianiline, p'-amino-p-aminoazobenzene, 4,4'-azobisbenzenamine, benzenamine, 4,4'-azobis, 4,4-azodianiline, 4,4'-diazenediylbisaniline | |
| 4-[(4-aminophenyl)diazenyl]aniline |
Specifications
| 538-41-0 | |
| 100.0 | |
| Brown | |
| 95% | |
| C12H12N4 | |
| 5 g | |
| 4,4'-azodianiline, p-azoaniline, p-diaminoazobenzene, 4,4'-diaminoazobenzene, azodianiline, p'-amino-p-aminoazobenzene, 4,4'-azobisbenzenamine, benzenamine, 4,4'-azobis, 4,4-azodianiline, 4,4'-diazenediylbisaniline | |
| KQIKKETXZQDHGE-UHFFFAOYSA-N | |
| 4-[(4-aminophenyl)diazenyl]aniline | |
| 10855 | |
| 95% | |
| 4, 4'-Azodianiline, 95% |
| 94.0 | |
| 245°C | |
| Authentic | |
| Glass bottle | |
| MFCD00041892 | |
| 15, 2979 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in ethanol,very soluble in benzene and chloroform | |
| NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1 | |
| 212.26 | |
| 212.25 | |
| Powder |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
Suspected of causing genetic defects.
GHS P Statement
IF exposed or concerned: Get medical advice/attention.
Do not handle until all safety precautions have been read and understood.
Wear protective gloves/protective clothing/eye protection/face protection.
Wash face,ha
GHS Signal Word: Warning
EINECSNumber : 208-690-7
RTECSNumber : BW7450000
TSCA : TSCA
RUO – Research Use Only