missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4'-Azodianiline, 95%, ACROS Organics™
$412.25 - $1,423.64
Chemical Identifiers
| CAS | 538-41-0 |
|---|---|
| Molecular Formula | C12H12N4 |
| Molecular Weight (g/mol) | 212.26 |
| MDL Number | MFCD00041892 |
| InChI Key | KQIKKETXZQDHGE-UHFFFAOYSA-N |
| Synonym | 4,4'-azobisbenzenamine, 4,4'-azodianiline, 4,4'-diaminoazobenzene, 4,4'-diazenediylbisaniline, 4,4-azodianiline, azodianiline, benzenamine, 4,4'-azobis, p'-amino-p-aminoazobenzene, p-azoaniline, p-diaminoazobenzene |
| PubChem CID | 10855 |
| IUPAC Name | 4-[(4-aminophenyl)diazenyl]aniline |
| SMILES | NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC401580050
|
Thermo Fisher Scientific
401580050 |
5g | Glass bottle |
Each for $412.25
|
|
AC401580250
|
Thermo Fisher Scientific
401580250 |
25g | Glass bottle |
Each for $1,423.64
|
|
Chemical Identifiers
| 538-41-0 | |
| 212.26 | |
| KQIKKETXZQDHGE-UHFFFAOYSA-N | |
| 10855 | |
| NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1 |
| C12H12N4 | |
| MFCD00041892 | |
| 4,4'-azobisbenzenamine, 4,4'-azodianiline, 4,4'-diaminoazobenzene, 4,4'-diazenediylbisaniline, 4,4-azodianiline, azodianiline, benzenamine, 4,4'-azobis, p'-amino-p-aminoazobenzene, p-azoaniline, p-diaminoazobenzene | |
| 4-[(4-aminophenyl)diazenyl]aniline |
Specifications
| Authentic | |
| Brown | |
| 5g | |
| 94.0 | |
| 95% | |
| MFCD00041892 | |
| 4,4'-azobisbenzenamine, 4,4'-azodianiline, 4,4'-diaminoazobenzene, 4,4'-diazenediylbisaniline, 4,4-azodianiline, azodianiline, benzenamine, 4,4'-azobis, p'-amino-p-aminoazobenzene, p-azoaniline, p-diaminoazobenzene | |
| KQIKKETXZQDHGE-UHFFFAOYSA-N | |
| 4-[(4-aminophenyl)diazenyl]aniline | |
| 10855 | |
| Powder | |
| 4, 4'-Azodianiline, 95% |
| Glass bottle | |
| 245°C | |
| 538-41-0 | |
| 100.0 | |
| C12H12N4 | |
| 15, 2979 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in ethanol,very soluble in benzene and chloroform | |
| NC1=CC=C(C=C1)N=NC1=CC=C(N)C=C1 | |
| 212.26 | |
| 212.25 | |
| 95% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
Suspected of causing genetic defects.
GHS P Statement
IF exposed or concerned: Get medical advice/attention.
Do not handle until all safety precautions have been read and understood.
Wear protective gloves/protective clothing/eye protection/face protection.
Wash face,ha
GHS Signal Word: Warning
EINECSNumber : 208-690-7
RTECSNumber : BW7450000
TSCA : TSCA