missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-[2-(tert-Butylamino)-1-methoxyethyl]-2-(hydroxymethyl)phenol, MilliporeSigma™ Supelco™
Supplier: Merck Emd Millipore 9280450MG
Specifications
| 870076-72-5 | |
| C14H23NO3 | |
| MFCD23160660 | |
| Salbutamol impurity A (PhEur); 5-[(1 RS)-2-[(1,1-Dimethylethyl)amino]-1-methoxyethyl]-2-hydroxyphenyl]methanol; 5-[2-[(1,1-Dimethylethyl)amino]-1-methoxyethyl]-2-hydroxybenzenemethanol | |
| COC(CNC(C)(C)C)C1=CC(CO)=C(O)C=C1 | |
| 253.34 | |
| ≥98% (HPLC) |
| 50 mg | |
| C14H23NO3 | |
| NONH for all modes of transport | |
| UMHASVFLCHGDPW-UHFFFAOYNA-N | |
| 4-[2-(tert-butylamino)-1-methoxyethyl]-2-(hydroxymethyl)phenol | |
| 253.34 |
Chemical Identifiers
| 870076-72-5 | |
| 253.34 | |
| UMHASVFLCHGDPW-UHFFFAOYNA-N | |
| 4-[2-(tert-butylamino)-1-methoxyethyl]-2-(hydroxymethyl)phenol |
| C14H23NO3 | |
| MFCD23160660 | |
| Salbutamol impurity A (PhEur); 5-[(1 RS)-2-[(1,1-Dimethylethyl)amino]-1-methoxyethyl]-2-hydroxyphenyl]methanol; 5-[2-[(1,1-Dimethylethyl)amino]-1-methoxyethyl]-2-hydroxybenzenemethanol | |
| COC(CNC(C)(C)C)C1=CC(CO)=C(O)C=C1 |
Safety and Handling
ShelfLife : Limited shelf life, expiry date on the label