missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-(2-Aminoethyl)Benzenesulfonyl Fluoride Hydrochloride, MP Biomedicals
$72.22 - $877.58
Chemical Identifiers
| CAS | 30827-99-7 |
|---|---|
| Molecular Formula | C8H11ClFNO2S |
| Molecular Weight (g/mol) | 239.689 |
| InChI Key | WRDABNWSWOHGMS-UHFFFAOYSA-N |
| Synonym | 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride, aebsf, aebsf hcl, aebsf hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, pefabloc, pefabloc sc |
| PubChem CID | 186136 |
| IUPAC Name | 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
| SMILES | C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN19350310
|
Mp Biomedicals
0219350310 |
10mg |
Each for $72.22
|
|
ICN19350380
|
Mp Biomedicals
0219350380 |
100mg |
Each for $248.11
|
|
ICN19350390
|
Mp Biomedicals
0219350390 |
500mg |
Each for $877.58
|
|
Chemical Identifiers
| 30827-99-7 | |
| 239.689 | |
| 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride, aebsf, aebsf hcl, aebsf hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, pefabloc, pefabloc sc | |
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
| C8H11ClFNO2S | |
| WRDABNWSWOHGMS-UHFFFAOYSA-N | |
| 186136 | |
| C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl |
Specifications
| 30827-99-7 | |
| 10mg | |
| WRDABNWSWOHGMS-UHFFFAOYSA-N | |
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride | |
| 186136 | |
| 4-(2-Aminoethyl)Benzenesulfonyl Fluoride Hydrochloride |
| C8H11ClFNO2S | |
| 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride, aebsf, aebsf hcl, aebsf hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, pefabloc, pefabloc sc | |
| C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl | |
| 239.689 | |
| 239.7 |