missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![[4-(1H-Pyrrol-1-yl)phenyl]methanol, 97%, Thermo Scientific™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-143426-51-1.jpg-650.jpg)
![[4-(1H-Pyrrol-1-yl)phenyl]methanol, 97%, Thermo Scientific™](https://assets.fishersci.com/TFS-Assets/CCG/product-images/maybridge.jpg-650.jpg)
[4-(1H-Pyrrol-1-yl)phenyl]methanol, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC25509DE
Specifications
| [4-(1H-Pyrrol-1-yl)phenyl]methanol | |
| 96.5 | |
| 97% | |
| MFCD03659708 | |
| 4-1h-pyrrol-1-yl phenyl methanol, 1-4-hydroxymethylphenyl pyrrole, 4-1h-pyrrol-1-yl benzyl alcohol, 4-pyrrol-1-yl phenyl methanol, benzenemethanol,4-1h-pyrrol-1-yl, 4-pyrrolylphenyl methan-1-ol, 4-1h-pyrrol-1-yl benzylalcohol, pubchem11303, 4-pyrrol-1-ylphenyl methanol | |
| C1=CN(C=C1)C2=CC=C(C=C2)CO | |
| 173.215 | |
| 173.21 |
| 143426-51-1 | |
| 100.0 | |
| C11H11NO | |
| 5g | |
| LQQQPLUFBVYLRE-UHFFFAOYSA-N | |
| (4-pyrrol-1-ylphenyl)methanol | |
| 599478 | |
| 97% |
Chemical Identifiers
| 143426-51-1 | |
| 173.215 | |
| LQQQPLUFBVYLRE-UHFFFAOYSA-N | |
| 599478 | |
| C1=CN(C=C1)C2=CC=C(C=C2)CO |
| C11H11NO | |
| MFCD03659708 | |
| 4-1h-pyrrol-1-yl phenyl methanol, 1-4-hydroxymethylphenyl pyrrole, 4-1h-pyrrol-1-yl benzyl alcohol, 4-pyrrol-1-yl phenyl methanol, benzenemethanol,4-1h-pyrrol-1-yl, 4-pyrrolylphenyl methan-1-ol, 4-1h-pyrrol-1-yl benzylalcohol, pubchem11303, 4-pyrrol-1-ylphenyl methanol | |
| (4-pyrrol-1-ylphenyl)methanol |