missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-[Tris(trimethylsilyloxy)silyl]propyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
$85.75 - $333.67
Chemical Identifiers
| CAS | 17096-07-0 |
|---|---|
| Molecular Formula | C16H38O5Si4 |
| Molecular Weight (g/mol) | 422.815 |
| MDL Number | MFCD00053871 |
| InChI Key | BESKSSIEODQWBP-UHFFFAOYSA-N |
| Synonym | 3-methacryloyloxy propyltris trimethylsiloxy silane, 3-tris trimethylsiloxy silyl propyl methacrylate, 3-1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy trisiloxan-3-yl propyl methacrylate, unii-d32s78j7t8, 3-methacryloyloxypropyl tris trimethylsiloxy silane, 3-methacryloxypropyltris trimethylsiloxy silane, 3-tris trimethylsilyloxy silyl propyl methacrylate, methacryloxypropyltris trimethylsiloxy silane, 3-3,3,3-trimethyl-1,1-bis trimethylsilyl oxy disiloxanyl propyl methacrylate |
| PubChem CID | 123371 |
| IUPAC Name | 3-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate |
| SMILES | CC(=C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
Chemical Identifiers
| 17096-07-0 | |
| 422.815 | |
| BESKSSIEODQWBP-UHFFFAOYSA-N | |
| 123371 | |
| CC(=C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| C16H38O5Si4 | |
| MFCD00053871 | |
| 3-methacryloyloxy propyltris trimethylsiloxy silane, 3-tris trimethylsiloxy silyl propyl methacrylate, 3-1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy trisiloxan-3-yl propyl methacrylate, unii-d32s78j7t8, 3-methacryloyloxypropyl tris trimethylsiloxy silane, 3-methacryloxypropyltris trimethylsiloxy silane, 3-tris trimethylsilyloxy silyl propyl methacrylate, methacryloxypropyltris trimethylsiloxy silane, 3-3,3,3-trimethyl-1,1-bis trimethylsilyl oxy disiloxanyl propyl methacrylate | |
| 3-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate |
Specifications
| 17096-07-0 | |
| 115°C | |
| MFCD00053871 | |
| 3-methacryloyloxy propyltris trimethylsiloxy silane, 3-tris trimethylsiloxy silyl propyl methacrylate, 3-1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy trisiloxan-3-yl propyl methacrylate, unii-d32s78j7t8, 3-methacryloyloxypropyl tris trimethylsiloxy silane, 3-methacryloxypropyltris trimethylsiloxy silane, 3-tris trimethylsilyloxy silyl propyl methacrylate, methacryloxypropyltris trimethylsiloxy silane, 3-3,3,3-trimethyl-1,1-bis trimethylsilyl oxy disiloxanyl propyl methacrylate | |
| CC(=C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C | |
| 422.815 | |
| 422.82 | |
| Liquid |
| Colorless | |
| C16H38O5Si4 | |
| 25 mL | |
| BESKSSIEODQWBP-UHFFFAOYSA-N | |
| 3-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate | |
| 123371 | |
| ≥98.0% (GC) | |
| 3-[Tris(trimethylsilyloxy)silyl]propyl Methacrylate (stabilized with MEHQ) |
Safety and Handling
EINECSNumber : (7)-0450
TSCA : No