Learn More
3-Nitrophthalimide, 98%
CAS: 603-62-3 | C8H4N2O4 | 192.13 g/mol
$73.10 - $692.00
Chemical Identifiers
| CAS | 603-62-3 |
|---|---|
| Molecular Formula | C8H4N2O4 |
| Molecular Weight (g/mol) | 192.13 |
| MDL Number | MFCD00041852 |
| InChI Key | BONIIQYTWOPUQI-UHFFFAOYSA-N |
| Synonym | 3-nitrophthalimide, 4-nitroisoindoline-1,3-dione, phthalimide, 3-nitro, 1h-isoindole-1,3 2h-dione, 4-nitro, nitrophthalimide, 4-nitro-2,3-dihydro-1h-isoindole-1,3-dione, 4-nitro-1h-isoindole-1,3 2h-dione, 4-nitro-2h-benzo c azoline-1,3-dione, 3-nitro-phthalimide, pubchem12007 |
| PubChem CID | 11779 |
| IUPAC Name | 4-nitroisoindole-1,3-dione |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NC2=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1529106
|
Thermo Scientific Chemicals
A1529106 |
5 g |
Each for $73.10
|
|
|||||
|
AAA1529114
|
Thermo Scientific Chemicals
A1529114 |
25 g |
Each for $245.38
|
|
|||||
|
AAA1529122
|
Thermo Scientific Chemicals
A1529122 |
100 g |
Each for $692.00
|
|
|||||
Description
3-Nitrophthalimide is a useful dye for biological research purposes. It is a nitro heterocyclic compounds found to exhibit potential antifungal activities.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Applications3-Nitrophthalimide is a useful dye for biological research purposes. It is a nitro heterocyclic compounds found to exhibit potential antifungal activities.
Solubility
Insoluble in water.
Notes
Store in a cool, dry, well-ventilated area away from incompatible substances such as oxidizing agents and bases.
Chemical Identifiers
| 603-62-3 | |
| 192.13 | |
| BONIIQYTWOPUQI-UHFFFAOYSA-N | |
| 11779 | |
| C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NC2=O |
| C8H4N2O4 | |
| MFCD00041852 | |
| 3-nitrophthalimide, 4-nitroisoindoline-1,3-dione, phthalimide, 3-nitro, 1h-isoindole-1,3 2h-dione, 4-nitro, nitrophthalimide, 4-nitro-2,3-dihydro-1h-isoindole-1,3-dione, 4-nitro-1h-isoindole-1,3 2h-dione, 4-nitro-2h-benzo c azoline-1,3-dione, 3-nitro-phthalimide, pubchem12007 | |
| 4-nitroisoindole-1,3-dione |
Specifications
| 603-62-3 | |
| C8H4N2O4 | |
| 5 g | |
| 3-nitrophthalimide, 4-nitroisoindoline-1,3-dione, phthalimide, 3-nitro, 1h-isoindole-1,3 2h-dione, 4-nitro, nitrophthalimide, 4-nitro-2,3-dihydro-1h-isoindole-1,3-dione, 4-nitro-1h-isoindole-1,3 2h-dione, 4-nitro-2h-benzo c azoline-1,3-dione, 3-nitro-phthalimide, pubchem12007 | |
| BONIIQYTWOPUQI-UHFFFAOYSA-N | |
| 4-nitroisoindole-1,3-dione | |
| 11779 | |
| 98% |
| 217°C to 221°C | |
| MFCD00041852 | |
| 179965 | |
| Insoluble in water. | |
| C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NC2=O | |
| 192.13 | |
| 192.13 | |
| 3-Nitrophthalimide |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
EINECSNumber : 210-051-2
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only