missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-Nitrophenylboronic Acid (contains varying amounts of Anhydride), TCI America™
$106.25 - $106.25
Identifiants chimiques
| CAS | 13331-27-6 |
|---|---|
| Molecular Formula | C6H6BNO4 |
| Molecular Weight (g/mol) | 166.93 |
| MDL Number | MFCD00007193 |
| InChI Key | ZNRGSYUVFVNSAW-UHFFFAOYSA-N |
| PubChem CID | 1677 |
| IUPAC Name | (3-nitrophenyl)boronic acid |
| SMILES | OB(O)C1=CC=CC(=C1)[N+]([O-])=O |
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Prix | Quantité | |||||
|---|---|---|---|---|---|---|---|---|---|
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Prix | Quantité | |||||
|
N05635G
|
TCI America
N05635G |
5 g |
chaque for $106.25
|
|
Connectez-vous ou enregistrez-vous pour vérifier votre prix et la disponibilité.
|
||||
Identifiants chimiques
| 13331-27-6 | |
| 166.93 | |
| ZNRGSYUVFVNSAW-UHFFFAOYSA-N | |
| (3-nitrophenyl)boronic acid |
| C6H6BNO4 | |
| MFCD00007193 | |
| 1677 | |
| OB(O)C1=CC=CC(=C1)[N+]([O-])=O |
Spécifications
| 13331-27-6 | |
| White-Yellow | |
| MFCD00007193 | |
| 3-nitrophenyl boronic acid, 3-nitrobenzeneboronic acid, m-nitrophenylboronic acid, boronic acid, 3-nitrophenyl, m-nitrobenzeneboronic acid, benzeneboronic acid, m-nitro, nitrophenylboronic acid, m-nitophenyl boronic acid, 3-nitrophenyl boranediol | |
| OB(O)C1=CC=CC(=C1)[N+]([O-])=O | |
| 166.93 | |
| 166.93 | |
| 3-Nitrophenylboronic Acid (contains varying amounts of Anhydride) |
| 268°C | |
| C6H6BNO4 | |
| 5 g | |
| ZNRGSYUVFVNSAW-UHFFFAOYSA-N | |
| (3-nitrophenyl)boronic acid | |
| 1677 | |
| Crystalline Powder |
Sécurité et manipulation
missing translation for 'rtecsNumber' : CY8980000
missing translation for 'tsca' : Yes