missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-Nitrophenylboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America N05635G
Specifications
| 3-Nitrophenylboronic Acid (contains varying amounts of Anhydride) | |
| 268°C | |
| C6H6BNO4 | |
| 5 g | |
| ZNRGSYUVFVNSAW-UHFFFAOYSA-N | |
| (3-nitrophenyl)boronic acid | |
| 1677 | |
| Crystalline Powder |
| 13331-27-6 | |
| White-Yellow | |
| MFCD00007193 | |
| 3-nitrophenyl boronic acid, 3-nitrobenzeneboronic acid, m-nitrophenylboronic acid, boronic acid, 3-nitrophenyl, m-nitrobenzeneboronic acid, benzeneboronic acid, m-nitro, nitrophenylboronic acid, m-nitophenyl boronic acid, 3-nitrophenyl boranediol | |
| OB(O)C1=CC=CC(=C1)[N+]([O-])=O | |
| 166.93 | |
| 166.93 |
Chemical Identifiers
| 13331-27-6 | |
| 166.93 | |
| ZNRGSYUVFVNSAW-UHFFFAOYSA-N | |
| (3-nitrophenyl)boronic acid |
| C6H6BNO4 | |
| MFCD00007193 | |
| 1677 | |
| OB(O)C1=CC=CC(=C1)[N+]([O-])=O |
Safety and Handling
RTECSNumber : CY8980000
TSCA : Yes