Learn More
3-Nitrobenzonitrile, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 173520250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 3-Nitrobenzonitrile | |
| 619-24-9 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| O2NC6H4CN | |
| 25g | |
| benzonitrile, 3-nitro, m-nitrobenzonitrile, 3-cyanonitrobenzene, m-cyanonitrobenzene, benzonitrile, m-nitro, 3-cyano-1-nitrobenzene, 3-nitro-benzonitrile, ccris 2327, 3-nitrobenzenecarbonitrile, 3-nitrobenzonitril | |
| RUSAWEHOGCWOPG-UHFFFAOYSA-N | |
| 3-nitrobenzonitrile | |
| 12079 | |
| 98% |
| 98% | |
| 97.5 | |
| 165°C (21.0mmHg) | |
| 98% | |
| C7H4N2O2 | |
| MFCD00007194 | |
| 09, 385 | |
| Solubility in water: insoluble. Other solubilities: freele soluble in ether and alcohol | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C#N | |
| 148.12 | |
| 148.12 |
Chemical Identifiers
| 619-24-9 | |
| 148.12 | |
| RUSAWEHOGCWOPG-UHFFFAOYSA-N | |
| 12079 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C#N |
| C7H4N2O2 | |
| MFCD00007194 | |
| benzonitrile, 3-nitro, m-nitrobenzonitrile, 3-cyanonitrobenzene, m-cyanonitrobenzene, benzonitrile, m-nitro, 3-cyano-1-nitrobenzene, 3-nitro-benzonitrile, ccris 2327, 3-nitrobenzenecarbonitrile, 3-nitrobenzonitril | |
| 3-nitrobenzonitrile |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Toxic in contact with skin.
Toxic if inhaled.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
Do not breathe dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Gently wash w
GHS Signal Word: Danger
EINECSNumber : 210-587-7
RTECSNumber : DI4900000
TSCA : TSCA
RUO â Research Use Only