missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-Methyl-2-oxobutanoic acid, sodium salt, 98+%
CAS: 3715-29-5 | C5H7NaO3 | 138.1 g/mol
$185.47 - $1637.45
Chemical Identifiers
| CAS | 3715-29-5 |
|---|---|
| Molecular Formula | C5H7NaO3 |
| Molecular Weight (g/mol) | 138.1 |
| MDL Number | MFCD00002581 |
| InChI Key | WIQBZDCJCRFGKA-UHFFFAOYSA-M |
| Synonym | sodium 3-methyl-2-oxobutanoate, ketovaline sodium salt, unii-5om3h751iu, butanoic acid, 3-methyl-2-oxo-, sodium salt, 3-methyl-2-oxobutyric acid sodium salt, 2-ketoisovaleric acid sodium salt, sodium 3-methyl-2-oxobutyrate, 3-methyl-2-oxobutanoic acid sodium salt, sodium dimethylpyruvate, ketovaline sodium |
| PubChem CID | 2724059 |
| IUPAC Name | sodium;3-methyl-2-oxobutanoate |
| SMILES | CC(C)C(=O)C(=O)[O-].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC189720010
|
Thermo Scientific Chemicals
189720010 |
1 g | Glass bottle |
Each for $185.47
|
|
||||
|
AC189720050
|
Thermo Scientific Chemicals
189720050 |
5 g | Glass bottle |
Each for $463.84
|
|
||||
|
AC189720250
|
Thermo Scientific Chemicals
189720250 |
25 g | Glass bottle |
Each for $1,637.45
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 3715-29-5 | |
| 138.1 | |
| WIQBZDCJCRFGKA-UHFFFAOYSA-M | |
| 2724059 | |
| CC(C)C(=O)C(=O)[O-].[Na+] |
| C5H7NaO3 | |
| MFCD00002581 | |
| sodium 3-methyl-2-oxobutanoate, ketovaline sodium salt, unii-5om3h751iu, butanoic acid, 3-methyl-2-oxo-, sodium salt, 3-methyl-2-oxobutyric acid sodium salt, 2-ketoisovaleric acid sodium salt, sodium 3-methyl-2-oxobutyrate, 3-methyl-2-oxobutanoic acid sodium salt, sodium dimethylpyruvate, ketovaline sodium | |
| sodium;3-methyl-2-oxobutanoate |
Specifications
| 3715-29-5 | |
| 100.0 | |
| Beige to Yellow or White | |
| 98+% | |
| C5H7NaO3 | |
| MFCD00002581 | |
| 03, 682 | |
| WIQBZDCJCRFGKA-UHFFFAOYSA-M | |
| sodium;3-methyl-2-oxobutanoate | |
| 2724059 | |
| 98+% | |
| 3-Methyl-2-oxobutanoic acid, sodium salt, 98+% |
| 98.0 | |
| 227°C to 231°C | |
| Authentic | |
| Glass bottle | |
| (CH3)2CHCOCO2Na | |
| 1 g | |
| sodium 3-methyl-2-oxobutanoate, ketovaline sodium salt, unii-5om3h751iu, butanoic acid, 3-methyl-2-oxo-, sodium salt, 3-methyl-2-oxobutyric acid sodium salt, 2-ketoisovaleric acid sodium salt, sodium 3-methyl-2-oxobutyrate, 3-methyl-2-oxobutanoic acid sodium salt, sodium dimethylpyruvate, ketovaline sodium | |
| CC(C)C(=O)C(=O)[O-].[Na+] | |
| 138.1 | |
| 138.1 | |
| Crystalline Powder or Crystals |
Safety and Handling
EINECSNumber : 223-062-2
TSCA : TSCA
RUO – Research Use Only