missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-Methyl-2-oxobutanoic acid, sodium salt, 98+%
CAS: 3715-29-5 | C5H7NaO3 | 138.1 g/mol
Supplier: Thermo Scientific Chemicals 189720250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 3-Methyl-2-oxobutanoic acid, sodium salt | |
| 3715-29-5 | |
| 100.0 | |
| Beige to Yellow or White | |
| 98+% | |
| C5H7NaO3 | |
| MFCD00002581 | |
| 03, 682 | |
| WIQBZDCJCRFGKA-UHFFFAOYSA-M | |
| sodium;3-methyl-2-oxobutanoate | |
| 2724059 | |
| 98+% |
| 98+% | |
| 98.0 | |
| 227°C to 231°C | |
| Authentic | |
| Glass bottle | |
| (CH3)2CHCOCO2Na | |
| 25 g | |
| sodium 3-methyl-2-oxobutanoate, ketovaline sodium salt, unii-5om3h751iu, butanoic acid, 3-methyl-2-oxo-, sodium salt, 3-methyl-2-oxobutyric acid sodium salt, 2-ketoisovaleric acid sodium salt, sodium 3-methyl-2-oxobutyrate, 3-methyl-2-oxobutanoic acid sodium salt, sodium dimethylpyruvate, ketovaline sodium | |
| CC(C)C(=O)C(=O)[O-].[Na+] | |
| 138.1 | |
| 138.1 | |
| Crystalline Powder or Crystals |
Chemical Identifiers
| 3715-29-5 | |
| 138.1 | |
| WIQBZDCJCRFGKA-UHFFFAOYSA-M | |
| 2724059 | |
| CC(C)C(=O)C(=O)[O-].[Na+] |
| C5H7NaO3 | |
| MFCD00002581 | |
| sodium 3-methyl-2-oxobutanoate, ketovaline sodium salt, unii-5om3h751iu, butanoic acid, 3-methyl-2-oxo-, sodium salt, 3-methyl-2-oxobutyric acid sodium salt, 2-ketoisovaleric acid sodium salt, sodium 3-methyl-2-oxobutyrate, 3-methyl-2-oxobutanoic acid sodium salt, sodium dimethylpyruvate, ketovaline sodium | |
| sodium;3-methyl-2-oxobutanoate |
Safety and Handling
EINECSNumber : 223-062-2
TSCA : TSCA
RUO – Research Use Only