missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-(Methoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America M19061G
Specifications
| 3-(Methoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride) | |
| 209°C | |
| C8H9BO4 | |
| 1 g | |
| ALTLCJHSJMGSLT-UHFFFAOYSA-N | |
| [3-(methoxycarbonyl)phenyl]boronic acid | |
| 2734714 | |
| Crystalline Powder |
| 99769-19-4 | |
| White-Yellow | |
| MFCD02093046 | |
| 3-methoxycarbonyl phenylboronic acid, 3-methoxycarbonylphenyl boronic acid, 3-methoxycarbonyl phenyl boronic acid, 3-methoxycarbonyl benzeneboronic acid, 3-methoxycarbonylphenylbaronic acid, methyl 3-dihydroxyboranyl benzoate, m-methoxycarbonyl phenylboronic acid, 3-carbomethoxy-phenylboronic acid | |
| COC(=O)C1=CC=CC(=C1)B(O)O | |
| 179.97 | |
| 179.97 |
Chemical Identifiers
| 99769-19-4 | |
| 179.97 | |
| ALTLCJHSJMGSLT-UHFFFAOYSA-N | |
| 2734714 | |
| COC(=O)C1=CC=CC(=C1)B(O)O |
| C8H9BO4 | |
| MFCD02093046 | |
| 3-methoxycarbonyl phenylboronic acid, 3-methoxycarbonylphenyl boronic acid, 3-methoxycarbonyl phenyl boronic acid, 3-methoxycarbonyl benzeneboronic acid, 3-methoxycarbonylphenylbaronic acid, methyl 3-dihydroxyboranyl benzoate, m-methoxycarbonyl phenylboronic acid, 3-carbomethoxy-phenylboronic acid | |
| [3-(methoxycarbonyl)phenyl]boronic acid |
Safety and Handling
TSCA : No