missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3'-Methoxybiphenyl-4-sulfonyl chloride, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 450480050
Specifications
| 3'-Methoxybiphenyl-4-sulfonyl chloride | |
| 94% min. (HPLC) | |
| 5g | |
| DVQBUJTYQXKLKZ-UHFFFAOYSA-N | |
| 4-(3-methoxyphenyl)benzenesulfonyl chloride | |
| 10826798 | |
| 95% |
| 186550-26-5 | |
| C13H11ClO3S | |
| 3'-methoxy-biphenyl-4-sulfonyl chloride, 3'-methoxybiphenyl-4-sulfonyl chloride, 3'-methoxy 1,1'-biphenyl-4-sulfonyl chloride, 3'-methoxy-1,1'-biphenyl-4-sulfonyl chloride, 1,1'-biphenyl-4-sulfonylchloride, 3'-methoxy, 4-3-methoxyphenyl benzenesulfonyl chloride, 3'-methoxy-biphenyl-4-sulfonylchloride, 3/'-methoxybiphenyl-4-sulfonyl chloride | |
| COC1=CC=CC(=C1)C2=CC=C(C=C2)S(=O)(=O)Cl | |
| 282.75 | |
| 282.75 |
Chemical Identifiers
| 186550-26-5 | |
| 282.75 | |
| 3'-methoxy-biphenyl-4-sulfonyl chloride, 3'-methoxybiphenyl-4-sulfonyl chloride, 3'-methoxy 1,1'-biphenyl-4-sulfonyl chloride, 3'-methoxy-1,1'-biphenyl-4-sulfonyl chloride, 1,1'-biphenyl-4-sulfonylchloride, 3'-methoxy, 4-3-methoxyphenyl benzenesulfonyl chloride, 3'-methoxy-biphenyl-4-sulfonylchloride, 3/'-methoxybiphenyl-4-sulfonyl chloride | |
| 4-(3-methoxyphenyl)benzenesulfonyl chloride |
| C13H11ClO3S | |
| DVQBUJTYQXKLKZ-UHFFFAOYSA-N | |
| 10826798 | |
| COC1=CC=CC(=C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Contact with water liberates toxic gas.
GHS Signal Word: Danger
RUO â Research Use Only