Learn More
3-Indolebutyric acid, 98%
CAS: 133-32-4 | C12H13NO2 | 203.24 g/mol
$91.58 - $893.64
Chemical Identifiers
| CAS | 133-32-4 |
|---|---|
| Molecular Formula | C12H13NO2 |
| Molecular Weight (g/mol) | 203.24 |
| MDL Number | MFCD00005664 |
| InChI Key | JTEDVYBZBROSJT-UHFFFAOYSA-N |
| Synonym | indole-3-butyric acid, 3-indolebutyric acid, 4-1h-indol-3-yl butanoic acid, indolebutyric acid, hormodin, 1h-indole-3-butanoic acid, seradix, indole-3-butanoic acid, jiffy grow, 4-indol-3-yl butyric acid |
| PubChem CID | 8617 |
| ChEBI | CHEBI:33070 |
| IUPAC Name | 4-(1H-indol-3-yl)butanoic acid |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC160690050
|
Thermo Scientific Chemicals
160690050 |
5 g | Glass bottle |
Each for $91.58
|
|
||||
|
AC160690250
|
Thermo Scientific Chemicals
160690250 |
25 g | Glass bottle |
Each for $281.83
|
|
||||
|
AC160691000
|
Thermo Scientific Chemicals
160691000 |
100 g | Glass bottle |
Each for $893.64
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 133-32-4 | |
| 203.24 | |
| JTEDVYBZBROSJT-UHFFFAOYSA-N | |
| 8617 | |
| 4-(1H-indol-3-yl)butanoic acid |
| C12H13NO2 | |
| MFCD00005664 | |
| indole-3-butyric acid, 3-indolebutyric acid, 4-1h-indol-3-yl butanoic acid, indolebutyric acid, hormodin, 1h-indole-3-butanoic acid, seradix, indole-3-butanoic acid, jiffy grow, 4-indol-3-yl butyric acid | |
| CHEBI:33070 | |
| C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O |
Specifications
| 133-32-4 | |
| 100.0 | |
| Colorless to Yellow | |
| 98% | |
| C12H13NO2 | |
| 5 g | |
| 15, 5005 | |
| Solubility in water: 250mg/l (20°C). Other solubilities: soluble in ethanol,ether,acetone,benzene,,dimethyl sulfoxide and petroleum ether,insoluble in chloroform,5% in ethanol: clear,brownish solution | |
| C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O | |
| 203.24 | |
| CHEBI:33070 | |
| 98% | |
| 3-Indolebutyric acid |
| 97.5 | |
| 120.0°C to 125.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00005664 | |
| 22, II, 54 | |
| indole-3-butyric acid, 3-indolebutyric acid, 4-1h-indol-3-yl butanoic acid, indolebutyric acid, hormodin, 1h-indole-3-butanoic acid, seradix, indole-3-butanoic acid, jiffy grow, 4-indol-3-yl butyric acid | |
| JTEDVYBZBROSJT-UHFFFAOYSA-N | |
| 4-(1H-indol-3-yl)butanoic acid | |
| 8617 | |
| 203.24 | |
| Liquid |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Toxic if swallowed.
Causes skin irritation.
May cause respiratory irritation.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye prot
GHS Signal Word: Danger
EINECSNumber : 205-101-5
RUO – Research Use Only